C9H16O3 — CID 100980301
ethyl 2-[(1R,2S)-2-hydroxy-3-methylcyclobutyl]acetate (PubChem CID 100980301) has the molecular formula C9H16O3 and a molecular weight of 172.22 g/mol. Its IUPAC name is ethyl 2-[(1R,2S)-2-hydroxy-3-methylcyclobutyl]acetate.
| Compound Name | ethyl 2-[(1R,2S)-2-hydroxy-3-methylcyclobutyl]acetate |
|---|---|
| PubChem CID | 100980301 |
| Molecular Formula | C9H16O3 |
| Molecular Weight | 172.22 g/mol |
| Exact Mass | 172.11 |
| IUPAC Name | ethyl 2-[(1R,2S)-2-hydroxy-3-methylcyclobutyl]acetate |
| SMILES | CCOC(=O)C[C@H]1CC(C)[C@@H]1O |
| InChI | InChI=1S/C9H16O3/c1-3-12-8(10)5-7-4-6(2)9(7)11/h6-7,9,11H,3-5H2,1-2H3/t6?,7-,9+/m1/s1 |
| InChIKey | ATKRFGBXGJNBFK-HEWOVZETSA-N |
| XLogP | 0.96 |
| TPSA | 46.53 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 12 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 172.22 |
| LogP ≤ 5 | 0.96 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |