C16H18O2S — CID 100980451
(4S,7aS)-4-(benzenesulfonyl)-7a-methyl-1,2,4,5-tetrahydroindene (PubChem CID 100980451) has the molecular formula C16H18O2S and a molecular weight of 274.38 g/mol. Its IUPAC name is (4S,7aS)-4-(benzenesulfonyl)-7a-methyl-1,2,4,5-tetrahydroindene.
| Compound Name | (4S,7aS)-4-(benzenesulfonyl)-7a-methyl-1,2,4,5-tetrahydroindene |
|---|---|
| PubChem CID | 100980451 |
| Molecular Formula | C16H18O2S |
| Molecular Weight | 274.38 g/mol |
| Exact Mass | 274.10 |
| IUPAC Name | (4S,7aS)-4-(benzenesulfonyl)-7a-methyl-1,2,4,5-tetrahydroindene |
| SMILES | C[C@]12C=CC[C@H](S(=O)(=O)c3ccccc3)C1=CCC2 |
| InChI | InChI=1S/C16H18O2S/c1-16-11-5-9-14(16)15(10-6-12-16)19(17,18)13-7-3-2-4-8-13/h2-4,6-9,12,15H,5,10-11H2,1H3/t15-,16-/m0/s1 |
| InChIKey | KBKLKYFSEFNWET-HOTGVXAUSA-N |
| XLogP | 3.52 |
| TPSA | 34.14 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 19 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 274.38 |
| LogP ≤ 5 | 3.52 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|