About (5Z)-3,4-bis(phenylmethoxy)-5-[2-(6-pyrrol-1-ylpurin-9-yl)ethylidene]oxolan-2-one
(5Z)-3,4-bis(phenylmethoxy)-5-[2-(6-pyrrol-1-ylpurin-9-yl)ethylidene]oxolan-2-one (PubChem CID 100980520) has the molecular formula C29H25N5O4
and a molecular weight of 507.55 g/mol. Its IUPAC name is (5Z)-3,4-bis(phenylmethoxy)-5-[2-(6-pyrrol-1-ylpurin-9-yl)ethylidene]oxolan-2-one.
Molecular Properties
| Compound Name | (5Z)-3,4-bis(phenylmethoxy)-5-[2-(6-pyrrol-1-ylpurin-9-yl)ethylidene]oxolan-2-one |
| PubChem CID | 100980520 |
| Molecular Formula | C29H25N5O4 |
| Molecular Weight | 507.55 g/mol |
| Exact Mass | 507.19 |
| IUPAC Name | (5Z)-3,4-bis(phenylmethoxy)-5-[2-(6-pyrrol-1-ylpurin-9-yl)ethylidene]oxolan-2-one |
| SMILES | O=C1O/C(=C\Cn2cnc3c(-n4cccc4)ncnc32)C(OCc2ccccc2)C1OCc1ccccc1 |
| InChI | InChI=1S/C29H25N5O4/c35-29-26(37-18-22-11-5-2-6-12-22)25(36-17-21-9-3-1-4-10-21)23(38-29)13-16-34-20-32-24-27(30-19-31-28(24)34)33-14-7-8-15-33/h1-15,19-20,25-26H,16-18H2/b23-13- |
| InChIKey | SZOLUZCMXHREFS-QRVIBDJDSA-N |
| XLogP | 4.23 |
| TPSA | 93.29 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 9 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 38 |
| Complexity | — |
Lipinski Rule of Five
1 violation
| Rule | Value |
| MW ≤ 500 | 507.55 |
| LogP ≤ 5 | 4.23 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 9 |
Analyze (5Z)-3,4-bis(phenylmethoxy)-5-[2-(6-pyrrol-1-ylpurin-9-yl)ethylidene]oxolan-2-one with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of (5Z)-3,4-bis(phenylmethoxy)-5-[2-(6-pyrrol-1-ylpurin-9-yl)ethylidene]oxolan-2-one?
The IUPAC name of (5Z)-3,4-bis(phenylmethoxy)-5-[2-(6-pyrrol-1-ylpurin-9-yl)ethylidene]oxolan-2-one (CID 100980520) is (5Z)-3,4-bis(phenylmethoxy)-5-[2-(6-pyrrol-1-ylpurin-9-yl)ethylidene]oxolan-2-one.
What is the SMILES notation for (5Z)-3,4-bis(phenylmethoxy)-5-[2-(6-pyrrol-1-ylpurin-9-yl)ethylidene]oxolan-2-one?
The canonical SMILES for (5Z)-3,4-bis(phenylmethoxy)-5-[2-(6-pyrrol-1-ylpurin-9-yl)ethylidene]oxolan-2-one is O=C1O/C(=C\Cn2cnc3c(-n4cccc4)ncnc32)C(OCc2ccccc2)C1OCc1ccccc1.
What is the InChIKey of (5Z)-3,4-bis(phenylmethoxy)-5-[2-(6-pyrrol-1-ylpurin-9-yl)ethylidene]oxolan-2-one?
The InChIKey is SZOLUZCMXHREFS-QRVIBDJDSA-N. The full InChI is InChI=1S/C29H25N5O4/c35-29-26(37-18-22-11-5-2-6-12-22)25(36-17-21-9-3-1-4-10-21)23(38-29)13-16-34-20-32-24-27(30-19-31-28(24)34)33-14-7-8-15-33/h1-15,19-20,25-26H,16-18H2/b23-13-.
What are the key properties of (5Z)-3,4-bis(phenylmethoxy)-5-[2-(6-pyrrol-1-ylpurin-9-yl)ethylidene]oxolan-2-one?
(5Z)-3,4-bis(phenylmethoxy)-5-[2-(6-pyrrol-1-ylpurin-9-yl)ethylidene]oxolan-2-one has a molecular weight of 507.55 g/mol, XLogP of 4.23, 9 rotatable bonds, 0 hydrogen bond donors, and 9 hydrogen bond acceptors.
Where does this data come from?
All data for (5Z)-3,4-bis(phenylmethoxy)-5-[2-(6-pyrrol-1-ylpurin-9-yl)ethylidene]oxolan-2-one is sourced from PubChem (CID 100980520), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).