C12H24O3 — CID 100980564
(2R,4R,6R)-5,5-dimethyl-2,6-di(propan-2-yl)-1,3-dioxan-4-ol (PubChem CID 100980564) has the molecular formula C12H24O3 and a molecular weight of 216.32 g/mol. Its IUPAC name is (2R,4R,6R)-5,5-dimethyl-2,6-di(propan-2-yl)-1,3-dioxan-4-ol.
| Compound Name | (2R,4R,6R)-5,5-dimethyl-2,6-di(propan-2-yl)-1,3-dioxan-4-ol |
|---|---|
| PubChem CID | 100980564 |
| Molecular Formula | C12H24O3 |
| Molecular Weight | 216.32 g/mol |
| Exact Mass | 216.17 |
| IUPAC Name | (2R,4R,6R)-5,5-dimethyl-2,6-di(propan-2-yl)-1,3-dioxan-4-ol |
| SMILES | CC(C)[C@H]1O[C@@H](O)C(C)(C)[C@@H](C(C)C)O1 |
| InChI | InChI=1S/C12H24O3/c1-7(2)9-12(5,6)11(13)15-10(14-9)8(3)4/h7-11,13H,1-6H3/t9-,10-,11-/m1/s1 |
| InChIKey | ZMWJLHAYQAGTQE-GMTAPVOTSA-N |
| XLogP | 2.38 |
| TPSA | 38.69 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 15 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 216.32 |
| LogP ≤ 5 | 2.38 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |