About 1-(2,2-difluoro-3-hexyl-1-trimethylsilylcyclopropyl)ethyl acetate
1-(2,2-difluoro-3-hexyl-1-trimethylsilylcyclopropyl)ethyl acetate (PubChem CID 100980859) has the molecular formula C16H30F2O2Si
and a molecular weight of 320.50 g/mol. Its IUPAC name is 1-(2,2-difluoro-3-hexyl-1-trimethylsilylcyclopropyl)ethyl acetate.
Molecular Properties
| Compound Name | 1-(2,2-difluoro-3-hexyl-1-trimethylsilylcyclopropyl)ethyl acetate |
| PubChem CID | 100980859 |
| Molecular Formula | C16H30F2O2Si |
| Molecular Weight | 320.50 g/mol |
| Exact Mass | 320.20 |
| IUPAC Name | 1-(2,2-difluoro-3-hexyl-1-trimethylsilylcyclopropyl)ethyl acetate |
| SMILES | CCCCCCC1C(F)(F)C1(C(C)OC(C)=O)[Si](C)(C)C |
| InChI | InChI=1S/C16H30F2O2Si/c1-7-8-9-10-11-14-15(16(14,17)18,21(4,5)6)12(2)20-13(3)19/h12,14H,7-11H2,1-6H3 |
| InChIKey | UZCPUFZLTTXAHT-UHFFFAOYSA-N |
| XLogP | 5.25 |
| TPSA | 26.30 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 21 |
| Complexity | — |
Lipinski Rule of Five
1 violation
| Rule | Value |
| MW ≤ 500 | 320.50 |
| LogP ≤ 5 | 5.25 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'heavy_metal', 'substructure': 'N/A'} |
|---|
Analyze 1-(2,2-difluoro-3-hexyl-1-trimethylsilylcyclopropyl)ethyl acetate with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 1-(2,2-difluoro-3-hexyl-1-trimethylsilylcyclopropyl)ethyl acetate?
The IUPAC name of 1-(2,2-difluoro-3-hexyl-1-trimethylsilylcyclopropyl)ethyl acetate (CID 100980859) is 1-(2,2-difluoro-3-hexyl-1-trimethylsilylcyclopropyl)ethyl acetate.
What is the SMILES notation for 1-(2,2-difluoro-3-hexyl-1-trimethylsilylcyclopropyl)ethyl acetate?
The canonical SMILES for 1-(2,2-difluoro-3-hexyl-1-trimethylsilylcyclopropyl)ethyl acetate is CCCCCCC1C(F)(F)C1(C(C)OC(C)=O)[Si](C)(C)C.
What is the InChIKey of 1-(2,2-difluoro-3-hexyl-1-trimethylsilylcyclopropyl)ethyl acetate?
The InChIKey is UZCPUFZLTTXAHT-UHFFFAOYSA-N. The full InChI is InChI=1S/C16H30F2O2Si/c1-7-8-9-10-11-14-15(16(14,17)18,21(4,5)6)12(2)20-13(3)19/h12,14H,7-11H2,1-6H3.
What are the key properties of 1-(2,2-difluoro-3-hexyl-1-trimethylsilylcyclopropyl)ethyl acetate?
1-(2,2-difluoro-3-hexyl-1-trimethylsilylcyclopropyl)ethyl acetate has a molecular weight of 320.50 g/mol, XLogP of 5.25, 8 rotatable bonds, 0 hydrogen bond donors, and 2 hydrogen bond acceptors.
Where does this data come from?
All data for 1-(2,2-difluoro-3-hexyl-1-trimethylsilylcyclopropyl)ethyl acetate is sourced from PubChem (CID 100980859), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).