C13H23NO2 — CID 100980868
9a-pentyl-2,3,4,7,8,9-hexahydropyrido[2,1-b][1,3]oxazin-6-one (PubChem CID 100980868) has the molecular formula C13H23NO2 and a molecular weight of 225.33 g/mol. Its IUPAC name is 9a-pentyl-2,3,4,7,8,9-hexahydropyrido[2,1-b][1,3]oxazin-6-one.
| Compound Name | 9a-pentyl-2,3,4,7,8,9-hexahydropyrido[2,1-b][1,3]oxazin-6-one |
|---|---|
| PubChem CID | 100980868 |
| Molecular Formula | C13H23NO2 |
| Molecular Weight | 225.33 g/mol |
| Exact Mass | 225.17 |
| IUPAC Name | 9a-pentyl-2,3,4,7,8,9-hexahydropyrido[2,1-b][1,3]oxazin-6-one |
| SMILES | CCCCCC12CCCC(=O)N1CCCO2 |
| InChI | InChI=1S/C13H23NO2/c1-2-3-4-8-13-9-5-7-12(15)14(13)10-6-11-16-13/h2-11H2,1H3 |
| InChIKey | AFFIYOASUZOHMF-UHFFFAOYSA-N |
| XLogP | 2.70 |
| TPSA | 29.54 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 16 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 225.33 |
| LogP ≤ 5 | 2.70 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|