C17H15NO4 — CID 100980878
(3S,4R,9S,10R)-3,4,9,10-tetrahydrobenzo[c]phenanthridine-3,4,9,10-tetrol (PubChem CID 100980878) has the molecular formula C17H15NO4 and a molecular weight of 297.31 g/mol. Its IUPAC name is (3S,4R,9S,10R)-3,4,9,10-tetrahydrobenzo[c]phenanthridine-3,4,9,10-tetrol.
| Compound Name | (3S,4R,9S,10R)-3,4,9,10-tetrahydrobenzo[c]phenanthridine-3,4,9,10-tetrol |
|---|---|
| PubChem CID | 100980878 |
| Molecular Formula | C17H15NO4 |
| Molecular Weight | 297.31 g/mol |
| Exact Mass | 297.10 |
| IUPAC Name | (3S,4R,9S,10R)-3,4,9,10-tetrahydrobenzo[c]phenanthridine-3,4,9,10-tetrol |
| SMILES | O[C@@H]1c2c(cnc3c4c(ccc23)C=C[C@H](O)[C@@H]4O)C=C[C@@H]1O |
| InChI | InChI=1S/C17H15NO4/c19-11-6-3-9-7-18-15-10(13(9)16(11)21)4-1-8-2-5-12(20)17(22)14(8)15/h1-7,11-12,16-17,19-22H/t11-,12-,16-,17-/m0/s1 |
| InChIKey | NLTUSMSWAFNMJO-SYWGBEHUSA-N |
| XLogP | 1.08 |
| TPSA | 93.81 Ų |
| H-Bond Donors | 4 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | |
| Heavy Atoms | 22 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 297.31 |
| LogP ≤ 5 | 1.08 |
| H-Bond Donors ≤ 5 | 4 |
| H-Bond Acceptors ≤ 10 | 5 |