C29H31NO4SSi — CID 10098091
S-phenyl (2R,3S)-3-[tert-butyl(dimethyl)silyl]oxy-2-(1,3-dioxoisoindol-2-yl)-3-phenylpropanethioate (PubChem CID 10098091) has the molecular formula C29H31NO4SSi and a molecular weight of 517.72 g/mol. Its IUPAC name is S-phenyl (2R,3S)-3-[tert-butyl(dimethyl)silyl]oxy-2-(1,3-dioxoisoindol-2-yl)-3-phenylpropanethioate.
| Compound Name | S-phenyl (2R,3S)-3-[tert-butyl(dimethyl)silyl]oxy-2-(1,3-dioxoisoindol-2-yl)-3-phenylpropanethioate |
|---|---|
| PubChem CID | 10098091 |
| Molecular Formula | C29H31NO4SSi |
| Molecular Weight | 517.72 g/mol |
| Exact Mass | 517.17 |
| IUPAC Name | S-phenyl (2R,3S)-3-[tert-butyl(dimethyl)silyl]oxy-2-(1,3-dioxoisoindol-2-yl)-3-phenylpropanethioate |
| SMILES | CC(C)(C)[Si](C)(C)O[C@@H](c1ccccc1)[C@H](C(=O)Sc1ccccc1)N1C(=O)c2ccccc2C1=O |
| InChI | InChI=1S/C29H31NO4SSi/c1-29(2,3)36(4,5)34-25(20-14-8-6-9-15-20)24(28(33)35-21-16-10-7-11-17-21)30-26(31)22-18-12-13-19-23(22)27(30)32/h6-19,24-25H,1-5H3/t24-,25+/m1/s1 |
| InChIKey | MRHGAGFPRWSUDG-RPBOFIJWSA-N |
| XLogP | 6.73 |
| TPSA | 63.68 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 36 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 517.72 |
| LogP ≤ 5 | 6.73 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'heavy_metal', 'substructure': 'N/A'}, {'alert_name': 'phthalimide', 'substructure': 'N/A'}, {'alert_name': 'thioester', 'substructure': 'N/A'} |
|---|