C22H23BrN4O4S — CID 10098145
1-[(E)-1-bromo-1-(2-methoxyphenyl)-3-oxo-3-piperidin-1-ylprop-1-en-2-yl]-3-(4-nitrophenyl)thiourea (PubChem CID 10098145) has the molecular formula C22H23BrN4O4S and a molecular weight of 519.42 g/mol. Its IUPAC name is 1-[(E)-1-bromo-1-(2-methoxyphenyl)-3-oxo-3-piperidin-1-ylprop-1-en-2-yl]-3-(4-nitrophenyl)thiourea.
| Compound Name | 1-[(E)-1-bromo-1-(2-methoxyphenyl)-3-oxo-3-piperidin-1-ylprop-1-en-2-yl]-3-(4-nitrophenyl)thiourea |
|---|---|
| PubChem CID | 10098145 |
| Molecular Formula | C22H23BrN4O4S |
| Molecular Weight | 519.42 g/mol |
| Exact Mass | 518.06 |
| IUPAC Name | 1-[(E)-1-bromo-1-(2-methoxyphenyl)-3-oxo-3-piperidin-1-ylprop-1-en-2-yl]-3-(4-nitrophenyl)thiourea |
| SMILES | COc1ccccc1/C(Br)=C(\NC(=S)Nc1ccc([N+](=O)[O-])cc1)C(=O)N1CCCCC1 |
| InChI | InChI=1S/C22H23BrN4O4S/c1-31-18-8-4-3-7-17(18)19(23)20(21(28)26-13-5-2-6-14-26)25-22(32)24-15-9-11-16(12-10-15)27(29)30/h3-4,7-12H,2,5-6,13-14H2,1H3,(H2,24,25,32)/b20-19+ |
| InChIKey | DMNHDDDUUKRJRR-FMQUCBEESA-N |
| XLogP | 4.67 |
| TPSA | 96.74 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 32 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 519.42 |
| LogP ≤ 5 | 4.67 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'}, {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'}, {'alert_name': 'Thiocarbonyl_group', 'substructure': 'N/A'} |
|---|