About (3R,5R)-5-phenyl-3-prop-2-enyl-1,2-oxazolidine
(3R,5R)-5-phenyl-3-prop-2-enyl-1,2-oxazolidine (PubChem CID 100981760) has the molecular formula C12H15NO
and a molecular weight of 189.26 g/mol. Its IUPAC name is (3R,5R)-5-phenyl-3-prop-2-enyl-1,2-oxazolidine.
Molecular Properties
| Compound Name | (3R,5R)-5-phenyl-3-prop-2-enyl-1,2-oxazolidine |
| PubChem CID | 100981760 |
| Molecular Formula | C12H15NO |
| Molecular Weight | 189.26 g/mol |
| Exact Mass | 189.12 |
| IUPAC Name | (3R,5R)-5-phenyl-3-prop-2-enyl-1,2-oxazolidine |
| SMILES | C=CC[C@@H]1C[C@H](c2ccccc2)ON1 |
| InChI | InChI=1S/C12H15NO/c1-2-6-11-9-12(14-13-11)10-7-4-3-5-8-10/h2-5,7-8,11-13H,1,6,9H2/t11-,12-/m1/s1 |
| InChIKey | ZVPCNYVAAFTYNA-VXGBXAGGSA-N |
| XLogP | 2.60 |
| TPSA | 21.26 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 14 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 189.26 |
| LogP ≤ 5 | 2.60 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|
Analyze (3R,5R)-5-phenyl-3-prop-2-enyl-1,2-oxazolidine with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of (3R,5R)-5-phenyl-3-prop-2-enyl-1,2-oxazolidine?
The IUPAC name of (3R,5R)-5-phenyl-3-prop-2-enyl-1,2-oxazolidine (CID 100981760) is (3R,5R)-5-phenyl-3-prop-2-enyl-1,2-oxazolidine.
What is the SMILES notation for (3R,5R)-5-phenyl-3-prop-2-enyl-1,2-oxazolidine?
The canonical SMILES for (3R,5R)-5-phenyl-3-prop-2-enyl-1,2-oxazolidine is C=CC[C@@H]1C[C@H](c2ccccc2)ON1.
What is the InChIKey of (3R,5R)-5-phenyl-3-prop-2-enyl-1,2-oxazolidine?
The InChIKey is ZVPCNYVAAFTYNA-VXGBXAGGSA-N. The full InChI is InChI=1S/C12H15NO/c1-2-6-11-9-12(14-13-11)10-7-4-3-5-8-10/h2-5,7-8,11-13H,1,6,9H2/t11-,12-/m1/s1.
What are the key properties of (3R,5R)-5-phenyl-3-prop-2-enyl-1,2-oxazolidine?
(3R,5R)-5-phenyl-3-prop-2-enyl-1,2-oxazolidine has a molecular weight of 189.26 g/mol, XLogP of 2.60, 3 rotatable bonds, 1 hydrogen bond donors, and 2 hydrogen bond acceptors.
Where does this data come from?
All data for (3R,5R)-5-phenyl-3-prop-2-enyl-1,2-oxazolidine is sourced from PubChem (CID 100981760), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).