C15H28O5 — CID 100982287
(1S,2S,3S,4S)-1-[(2S)-2-hydroxy-6-methylhept-5-en-2-yl]-4-methylcyclohexane-1,2,3,4-tetrol (PubChem CID 100982287) has the molecular formula C15H28O5 and a molecular weight of 288.38 g/mol. Its IUPAC name is (1S,2S,3S,4S)-1-[(2S)-2-hydroxy-6-methylhept-5-en-2-yl]-4-methylcyclohexane-1,2,3,4-tetrol.
| Compound Name | (1S,2S,3S,4S)-1-[(2S)-2-hydroxy-6-methylhept-5-en-2-yl]-4-methylcyclohexane-1,2,3,4-tetrol |
|---|---|
| PubChem CID | 100982287 |
| Molecular Formula | C15H28O5 |
| Molecular Weight | 288.38 g/mol |
| Exact Mass | 288.19 |
| IUPAC Name | (1S,2S,3S,4S)-1-[(2S)-2-hydroxy-6-methylhept-5-en-2-yl]-4-methylcyclohexane-1,2,3,4-tetrol |
| SMILES | CC(C)=CCC[C@](C)(O)[C@]1(O)CC[C@](C)(O)[C@@H](O)[C@@H]1O |
| InChI | InChI=1S/C15H28O5/c1-10(2)6-5-7-14(4,19)15(20)9-8-13(3,18)11(16)12(15)17/h6,11-12,16-20H,5,7-9H2,1-4H3/t11-,12-,13-,14-,15-/m0/s1 |
| InChIKey | NHBJWMZRJYBAPG-YTFOTSKYSA-N |
| XLogP | 0.48 |
| TPSA | 101.15 Ų |
| H-Bond Donors | 5 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 20 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 288.38 |
| LogP ≤ 5 | 0.48 |
| H-Bond Donors ≤ 5 | 5 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|