C11H14NO6P — CID 100982764
(4R,6S)-4,6-dimethyl-2-(4-nitrophenoxy)-2-oxido-1,3,2-dioxaphosphinan-2-ium (PubChem CID 100982764) has the molecular formula C11H14NO6P and a molecular weight of 287.21 g/mol. Its IUPAC name is (4R,6S)-4,6-dimethyl-2-(4-nitrophenoxy)-2-oxido-1,3,2-dioxaphosphinan-2-ium.
| Compound Name | (4R,6S)-4,6-dimethyl-2-(4-nitrophenoxy)-2-oxido-1,3,2-dioxaphosphinan-2-ium |
|---|---|
| PubChem CID | 100982764 |
| Molecular Formula | C11H14NO6P |
| Molecular Weight | 287.21 g/mol |
| Exact Mass | 287.06 |
| IUPAC Name | (4R,6S)-4,6-dimethyl-2-(4-nitrophenoxy)-2-oxido-1,3,2-dioxaphosphinan-2-ium |
| SMILES | C[C@@H]1C[C@H](C)O[P+]([O-])(Oc2ccc([N+](=O)[O-])cc2)O1 |
| InChI | InChI=1S/C11H14NO6P/c1-8-7-9(2)17-19(15,16-8)18-11-5-3-10(4-6-11)12(13)14/h3-6,8-9H,7H2,1-2H3/t8-,9+,19? |
| InChIKey | HEJNFDCAAFTIKJ-MEQIZHTCSA-N |
| XLogP | 2.23 |
| TPSA | 93.89 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 19 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 287.21 |
| LogP ≤ 5 | 2.23 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'}, {'alert_name': 'phosphor', 'substructure': 'N/A'} |
|---|