C34H40N2O3 — CID 10098327
N-[3-(2,6-dimethylpiperidin-1-yl)propyl]-2,2-bis(4-methoxynaphthalen-1-yl)acetamide (PubChem CID 10098327) has the molecular formula C34H40N2O3 and a molecular weight of 524.71 g/mol. Its IUPAC name is N-[3-(2,6-dimethylpiperidin-1-yl)propyl]-2,2-bis(4-methoxynaphthalen-1-yl)acetamide.
| Compound Name | N-[3-(2,6-dimethylpiperidin-1-yl)propyl]-2,2-bis(4-methoxynaphthalen-1-yl)acetamide |
|---|---|
| PubChem CID | 10098327 |
| Molecular Formula | C34H40N2O3 |
| Molecular Weight | 524.71 g/mol |
| Exact Mass | 524.30 |
| IUPAC Name | N-[3-(2,6-dimethylpiperidin-1-yl)propyl]-2,2-bis(4-methoxynaphthalen-1-yl)acetamide |
| SMILES | COc1ccc(C(C(=O)NCCCN2C(C)CCCC2C)c2ccc(OC)c3ccccc23)c2ccccc12 |
| InChI | InChI=1S/C34H40N2O3/c1-23-11-9-12-24(2)36(23)22-10-21-35-34(37)33(29-17-19-31(38-3)27-15-7-5-13-25(27)29)30-18-20-32(39-4)28-16-8-6-14-26(28)30/h5-8,13-20,23-24,33H,9-12,21-22H2,1-4H3,(H,35,37) |
| InChIKey | WJSFCSSZMOGVJK-UHFFFAOYSA-N |
| XLogP | 6.91 |
| TPSA | 50.80 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 39 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 524.71 |
| LogP ≤ 5 | 6.91 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|