C22H29NO5 — CID 100983283
tert-butyl (2S)-1-[(2S,3R)-3-(1,3-benzodioxol-5-yl)-2-methylpent-4-enoyl]pyrrolidine-2-carboxylate (PubChem CID 100983283) has the molecular formula C22H29NO5 and a molecular weight of 387.48 g/mol. Its IUPAC name is tert-butyl (2S)-1-[(2S,3R)-3-(1,3-benzodioxol-5-yl)-2-methylpent-4-enoyl]pyrrolidine-2-carboxylate.
| Compound Name | tert-butyl (2S)-1-[(2S,3R)-3-(1,3-benzodioxol-5-yl)-2-methylpent-4-enoyl]pyrrolidine-2-carboxylate |
|---|---|
| PubChem CID | 100983283 |
| Molecular Formula | C22H29NO5 |
| Molecular Weight | 387.48 g/mol |
| Exact Mass | 387.20 |
| IUPAC Name | tert-butyl (2S)-1-[(2S,3R)-3-(1,3-benzodioxol-5-yl)-2-methylpent-4-enoyl]pyrrolidine-2-carboxylate |
| SMILES | C=C[C@@H](c1ccc2c(c1)OCO2)[C@H](C)C(=O)N1CCC[C@H]1C(=O)OC(C)(C)C |
| InChI | InChI=1S/C22H29NO5/c1-6-16(15-9-10-18-19(12-15)27-13-26-18)14(2)20(24)23-11-7-8-17(23)21(25)28-22(3,4)5/h6,9-10,12,14,16-17H,1,7-8,11,13H2,2-5H3/t14-,16+,17-/m0/s1 |
| InChIKey | SQGHURWGWWFVEE-UAGQMJEPSA-N |
| XLogP | 3.65 |
| TPSA | 65.07 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 28 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 387.48 |
| LogP ≤ 5 | 3.65 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|