C16H25NO2Si — CID 100983703
(3aR,7S,7aS)-7-(2-hydroxyethyl)-2-methyl-7a-(2-trimethylsilylethynyl)-3,3a,4,7-tetrahydroisoindol-1-one (PubChem CID 100983703) has the molecular formula C16H25NO2Si and a molecular weight of 291.47 g/mol. Its IUPAC name is (3aR,7S,7aS)-7-(2-hydroxyethyl)-2-methyl-7a-(2-trimethylsilylethynyl)-3,3a,4,7-tetrahydroisoindol-1-one.
| Compound Name | (3aR,7S,7aS)-7-(2-hydroxyethyl)-2-methyl-7a-(2-trimethylsilylethynyl)-3,3a,4,7-tetrahydroisoindol-1-one |
|---|---|
| PubChem CID | 100983703 |
| Molecular Formula | C16H25NO2Si |
| Molecular Weight | 291.47 g/mol |
| Exact Mass | 291.17 |
| IUPAC Name | (3aR,7S,7aS)-7-(2-hydroxyethyl)-2-methyl-7a-(2-trimethylsilylethynyl)-3,3a,4,7-tetrahydroisoindol-1-one |
| SMILES | CN1C[C@@H]2CC=C[C@H](CCO)[C@]2(C#C[Si](C)(C)C)C1=O |
| InChI | InChI=1S/C16H25NO2Si/c1-17-12-14-7-5-6-13(8-10-18)16(14,15(17)19)9-11-20(2,3)4/h5-6,13-14,18H,7-8,10,12H2,1-4H3/t13-,14+,16+/m1/s1 |
| InChIKey | UMFCLUJLBHKESG-YCPHGPKFSA-N |
| XLogP | 1.90 |
| TPSA | 40.54 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 20 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 291.47 |
| LogP ≤ 5 | 1.90 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'heavy_metal', 'substructure': 'N/A'}, {'alert_name': 'isolated_alkene', 'substructure': 'N/A'}, {'alert_name': 'triple_bond', 'substructure': 'N/A'} |
|---|