C30H42 — CID 100983893
1,3,3-trimethyl-2-[(1E,3E,5E,7E,9E,11E,13E)-3,7,12,16-tetramethylheptadeca-1,3,5,7,9,11,13,15-octaenyl]cyclohexene (PubChem CID 100983893) has the molecular formula C30H42 and a molecular weight of 402.67 g/mol. Its IUPAC name is 1,3,3-trimethyl-2-[(1E,3E,5E,7E,9E,11E,13E)-3,7,12,16-tetramethylheptadeca-1,3,5,7,9,11,13,15-octaenyl]cyclohexene.
| Compound Name | 1,3,3-trimethyl-2-[(1E,3E,5E,7E,9E,11E,13E)-3,7,12,16-tetramethylheptadeca-1,3,5,7,9,11,13,15-octaenyl]cyclohexene |
|---|---|
| PubChem CID | 100983893 |
| Molecular Formula | C30H42 |
| Molecular Weight | 402.67 g/mol |
| Exact Mass | 402.33 |
| IUPAC Name | 1,3,3-trimethyl-2-[(1E,3E,5E,7E,9E,11E,13E)-3,7,12,16-tetramethylheptadeca-1,3,5,7,9,11,13,15-octaenyl]cyclohexene |
| SMILES | CC(C)=C/C=C/C(C)=C/C=C/C=C(C)/C=C/C=C(C)/C=C/C1=C(C)CCCC1(C)C |
| InChI | InChI=1S/C30H42/c1-24(2)14-11-17-25(3)15-9-10-16-26(4)18-12-19-27(5)21-22-29-28(6)20-13-23-30(29,7)8/h9-12,14-19,21-22H,13,20,23H2,1-8H3/b10-9+,17-11+,18-12+,22-21+,25-15+,26-16+,27-19+ |
| InChIKey | HNRGUVICPOTIFA-VNDBSRAXSA-N |
| XLogP | 9.54 |
| TPSA | 0.00 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | |
| Rotatable Bonds | 8 |
| Heavy Atoms | 30 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 402.67 |
| LogP ≤ 5 | 9.54 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 0 |
| Structural Alerts | {'alert_name': 'polyene', 'substructure': 'N/A'} |
|---|