C25H36O2 — CID 100983928
(6aR,10aR)-6,6,9-trimethyl-1-pentyl-1,2,3,4,6a,7,10,10a-octahydronaphtho[1,2-c]isochromen-11-ol (PubChem CID 100983928) has the molecular formula C25H36O2 and a molecular weight of 368.56 g/mol. Its IUPAC name is (6aR,10aR)-6,6,9-trimethyl-1-pentyl-1,2,3,4,6a,7,10,10a-octahydronaphtho[1,2-c]isochromen-11-ol.
| Compound Name | (6aR,10aR)-6,6,9-trimethyl-1-pentyl-1,2,3,4,6a,7,10,10a-octahydronaphtho[1,2-c]isochromen-11-ol |
|---|---|
| PubChem CID | 100983928 |
| Molecular Formula | C25H36O2 |
| Molecular Weight | 368.56 g/mol |
| Exact Mass | 368.27 |
| IUPAC Name | (6aR,10aR)-6,6,9-trimethyl-1-pentyl-1,2,3,4,6a,7,10,10a-octahydronaphtho[1,2-c]isochromen-11-ol |
| SMILES | CCCCCC1CCCc2c1cc(O)c1c2OC(C)(C)[C@@H]2CC=C(C)C[C@@H]12 |
| InChI | InChI=1S/C25H36O2/c1-5-6-7-9-17-10-8-11-18-19(17)15-22(26)23-20-14-16(2)12-13-21(20)25(3,4)27-24(18)23/h12,15,17,20-21,26H,5-11,13-14H2,1-4H3/t17?,20-,21-/m1/s1 |
| InChIKey | OTQWDRFEQZJHSG-LTGQRPFBSA-N |
| XLogP | 7.00 |
| TPSA | 29.46 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 27 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 368.56 |
| LogP ≤ 5 | 7.00 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|