C19H15F9OS — CID 100984267
1-(3,3,4,4,5,5,6,6,6-nonafluorohexylsulfanylmethoxy)-3-phenylbenzene (PubChem CID 100984267) has the molecular formula C19H15F9OS and a molecular weight of 462.38 g/mol. Its IUPAC name is 1-(3,3,4,4,5,5,6,6,6-nonafluorohexylsulfanylmethoxy)-3-phenylbenzene.
| Compound Name | 1-(3,3,4,4,5,5,6,6,6-nonafluorohexylsulfanylmethoxy)-3-phenylbenzene |
|---|---|
| PubChem CID | 100984267 |
| Molecular Formula | C19H15F9OS |
| Molecular Weight | 462.38 g/mol |
| Exact Mass | 462.07 |
| IUPAC Name | 1-(3,3,4,4,5,5,6,6,6-nonafluorohexylsulfanylmethoxy)-3-phenylbenzene |
| SMILES | FC(F)(F)C(F)(F)C(F)(F)C(F)(F)CCSCOc1cccc(-c2ccccc2)c1 |
| InChI | InChI=1S/C19H15F9OS/c20-16(21,17(22,23)18(24,25)19(26,27)28)9-10-30-12-29-15-8-4-7-14(11-15)13-5-2-1-3-6-13/h1-8,11H,9-10,12H2 |
| InChIKey | LBCNBRBZYUMRCM-UHFFFAOYSA-N |
| XLogP | 7.28 |
| TPSA | 9.23 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 30 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 462.38 |
| LogP ≤ 5 | 7.28 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'het-C-het_not_in_ring', 'substructure': 'N/A'}, {'alert_name': 'Perfluorinated_chain', 'substructure': 'N/A'} |
|---|