C34H49F3O2 — CID 100984308
[(3S,5S,8R,9S,10S,13R,14S,17R)-10,13-dimethyl-17-[(2R)-6-methylheptan-2-yl]-2,3,4,5,6,7,8,9,11,12,14,15,16,17-tetradecahydro-1H-cyclopenta[a]phenanthren-3-yl] 3,4,5-trifluorobenzoate (PubChem CID 100984308) has the molecular formula C34H49F3O2 and a molecular weight of 546.76 g/mol. Its IUPAC name is [(3S,5S,8R,9S,10S,13R,14S,17R)-10,13-dimethyl-17-[(2R)-6-methylheptan-2-yl]-2,3,4,5,6,7,8,9,11,12,14,15,16,17-tetradecahydro-1H-cyclopenta[a]phenanthren-3-yl] 3,4,5-trifluorobenzoate.
| Compound Name | [(3S,5S,8R,9S,10S,13R,14S,17R)-10,13-dimethyl-17-[(2R)-6-methylheptan-2-yl]-2,3,4,5,6,7,8,9,11,12,14,15,16,17-tetradecahydro-1H-cyclopenta[a]phenanthren-3-yl] 3,4,5-trifluorobenzoate |
|---|---|
| PubChem CID | 100984308 |
| Molecular Formula | C34H49F3O2 |
| Molecular Weight | 546.76 g/mol |
| Exact Mass | 546.37 |
| IUPAC Name | [(3S,5S,8R,9S,10S,13R,14S,17R)-10,13-dimethyl-17-[(2R)-6-methylheptan-2-yl]-2,3,4,5,6,7,8,9,11,12,14,15,16,17-tetradecahydro-1H-cyclopenta[a]phenanthren-3-yl] 3,4,5-trifluorobenzoate |
| SMILES | CC(C)CCC[C@@H](C)[C@H]1CC[C@H]2[C@@H]3CC[C@H]4C[C@@H](OC(=O)c5cc(F)c(F)c(F)c5)CC[C@]4(C)[C@H]3CC[C@]12C |
| InChI | InChI=1S/C34H49F3O2/c1-20(2)7-6-8-21(3)26-11-12-27-25-10-9-23-19-24(13-15-33(23,4)28(25)14-16-34(26,27)5)39-32(38)22-17-29(35)31(37)30(36)18-22/h17-18,20-21,23-28H,6-16,19H2,1-5H3/t21-,23+,24+,25+,26-,27+,28+,33+,34-/m1/s1 |
| InChIKey | XLKIKMDVHJCXIZ-DAVCTHOISA-N |
| XLogP | 9.75 |
| TPSA | 26.30 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 39 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 546.76 |
| LogP ≤ 5 | 9.75 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'halogenated_ring_2', 'substructure': 'N/A'} |
|---|