C13H15NO3S2 — CID 100984325
4-[(2S,3R,4S,5S)-3,5-dihydroxy-4-methoxythian-2-yl]sulfanylbenzonitrile (PubChem CID 100984325) has the molecular formula C13H15NO3S2 and a molecular weight of 297.40 g/mol. Its IUPAC name is 4-[(2S,3R,4S,5S)-3,5-dihydroxy-4-methoxythian-2-yl]sulfanylbenzonitrile.
| Compound Name | 4-[(2S,3R,4S,5S)-3,5-dihydroxy-4-methoxythian-2-yl]sulfanylbenzonitrile |
|---|---|
| PubChem CID | 100984325 |
| Molecular Formula | C13H15NO3S2 |
| Molecular Weight | 297.40 g/mol |
| Exact Mass | 297.05 |
| IUPAC Name | 4-[(2S,3R,4S,5S)-3,5-dihydroxy-4-methoxythian-2-yl]sulfanylbenzonitrile |
| SMILES | CO[C@@H]1[C@@H](O)[C@H](Sc2ccc(C#N)cc2)SC[C@H]1O |
| InChI | InChI=1S/C13H15NO3S2/c1-17-12-10(15)7-18-13(11(12)16)19-9-4-2-8(6-14)3-5-9/h2-5,10-13,15-16H,7H2,1H3/t10-,11-,12+,13+/m1/s1 |
| InChIKey | ULAOZMDUVZUWLP-NDBYEHHHSA-N |
| XLogP | 1.46 |
| TPSA | 73.48 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 19 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 297.40 |
| LogP ≤ 5 | 1.46 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 6 |