C20H24O7 — CID 100984365
[(1R,2S,3S,7S,8S,9R,10R,13S)-9-hydroxy-13-methyl-6-methylidene-5,11-dioxo-4,12-dioxatetracyclo[8.5.0.02,13.03,7]pentadecan-8-yl] (Z)-2-methylbut-2-enoate (PubChem CID 100984365) has the molecular formula C20H24O7 and a molecular weight of 376.41 g/mol. Its IUPAC name is [(1R,2S,3S,7S,8S,9R,10R,13S)-9-hydroxy-13-methyl-6-methylidene-5,11-dioxo-4,12-dioxatetracyclo[8.5.0.02,13.03,7]pentadecan-8-yl] (Z)-2-methylbut-2-enoate.
| Compound Name | [(1R,2S,3S,7S,8S,9R,10R,13S)-9-hydroxy-13-methyl-6-methylidene-5,11-dioxo-4,12-dioxatetracyclo[8.5.0.02,13.03,7]pentadecan-8-yl] (Z)-2-methylbut-2-enoate |
|---|---|
| PubChem CID | 100984365 |
| Molecular Formula | C20H24O7 |
| Molecular Weight | 376.41 g/mol |
| Exact Mass | 376.15 |
| IUPAC Name | [(1R,2S,3S,7S,8S,9R,10R,13S)-9-hydroxy-13-methyl-6-methylidene-5,11-dioxo-4,12-dioxatetracyclo[8.5.0.02,13.03,7]pentadecan-8-yl] (Z)-2-methylbut-2-enoate |
| SMILES | C=C1C(=O)O[C@H]2[C@H]1[C@H](OC(=O)/C(C)=C\C)[C@H](O)[C@@H]1C(=O)O[C@@]3(C)CC[C@@H]1[C@@H]23 |
| InChI | InChI=1S/C20H24O7/c1-5-8(2)17(22)26-16-11-9(3)18(23)25-15(11)13-10-6-7-20(13,4)27-19(24)12(10)14(16)21/h5,10-16,21H,3,6-7H2,1-2,4H3/b8-5-/t10-,11-,12+,13-,14+,15-,16-,20-/m0/s1 |
| InChIKey | MUHBGPCDKPLZGI-MCESGJDGSA-N |
| XLogP | 1.29 |
| TPSA | 99.13 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 27 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 376.41 |
| LogP ≤ 5 | 1.29 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': '>_2_ester_groups', 'substructure': 'N/A'}, {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'} |
|---|