C11H18O3 — CID 100984466
(3'aS,7'aR)-spiro[1,3-dioxolane-2,4'-2,3,5,6,7,7a-hexahydro-1H-indene]-3'a-ol (PubChem CID 100984466) has the molecular formula C11H18O3 and a molecular weight of 198.26 g/mol. Its IUPAC name is (3'aS,7'aR)-spiro[1,3-dioxolane-2,4'-2,3,5,6,7,7a-hexahydro-1H-indene]-3'a-ol.
| Compound Name | (3'aS,7'aR)-spiro[1,3-dioxolane-2,4'-2,3,5,6,7,7a-hexahydro-1H-indene]-3'a-ol |
|---|---|
| PubChem CID | 100984466 |
| Molecular Formula | C11H18O3 |
| Molecular Weight | 198.26 g/mol |
| Exact Mass | 198.13 |
| IUPAC Name | (3'aS,7'aR)-spiro[1,3-dioxolane-2,4'-2,3,5,6,7,7a-hexahydro-1H-indene]-3'a-ol |
| SMILES | O[C@@]12CCC[C@@H]1CCCC21OCCO1 |
| InChI | InChI=1S/C11H18O3/c12-10-5-1-3-9(10)4-2-6-11(10)13-7-8-14-11/h9,12H,1-8H2/t9-,10+/m1/s1 |
| InChIKey | WPIKJXGSBFGOOG-ZJUUUORDSA-N |
| XLogP | 1.44 |
| TPSA | 38.69 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | |
| Heavy Atoms | 14 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 198.26 |
| LogP ≤ 5 | 1.44 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |