C28H42O7 — CID 100984581
(1S,4R,5R,7R,9R,13S,14R,15S)-4,15-dihydroxy-5,8,8,14-tetramethyl-9-[(1E,3E,5E)-7-methylocta-1,3,5-trienyl]-10,17,18-trioxatricyclo[11.3.1.14,7]octadecane-3,11-dione (PubChem CID 100984581) has the molecular formula C28H42O7 and a molecular weight of 490.64 g/mol. Its IUPAC name is (1S,4R,5R,7R,9R,13S,14R,15S)-4,15-dihydroxy-5,8,8,14-tetramethyl-9-[(1E,3E,5E)-7-methylocta-1,3,5-trienyl]-10,17,18-trioxatricyclo[11.3.1.14,7]octadecane-3,11-dione.
| Compound Name | (1S,4R,5R,7R,9R,13S,14R,15S)-4,15-dihydroxy-5,8,8,14-tetramethyl-9-[(1E,3E,5E)-7-methylocta-1,3,5-trienyl]-10,17,18-trioxatricyclo[11.3.1.14,7]octadecane-3,11-dione |
|---|---|
| PubChem CID | 100984581 |
| Molecular Formula | C28H42O7 |
| Molecular Weight | 490.64 g/mol |
| Exact Mass | 490.29 |
| IUPAC Name | (1S,4R,5R,7R,9R,13S,14R,15S)-4,15-dihydroxy-5,8,8,14-tetramethyl-9-[(1E,3E,5E)-7-methylocta-1,3,5-trienyl]-10,17,18-trioxatricyclo[11.3.1.14,7]octadecane-3,11-dione |
| SMILES | CC(C)/C=C/C=C/C=C/[C@H]1OC(=O)C[C@@H]2O[C@H](CC(=O)[C@]3(O)O[C@H](C[C@H]3C)C1(C)C)C[C@H](O)[C@H]2C |
| InChI | InChI=1S/C28H42O7/c1-17(2)11-9-7-8-10-12-24-27(5,6)25-13-18(3)28(32,35-25)23(30)15-20-14-21(29)19(4)22(33-20)16-26(31)34-24/h7-12,17-22,24-25,29,32H,13-16H2,1-6H3/b8-7+,11-9+,12-10+/t18-,19-,20+,21+,22+,24-,25-,28-/m1/s1 |
| InChIKey | FDQWXDJYVLMKEL-RJSQJMLMSA-N |
| XLogP | 3.88 |
| TPSA | 102.29 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 35 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 490.64 |
| LogP ≤ 5 | 3.88 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'polyene', 'substructure': 'N/A'} |
|---|