C9H14O5 — CID 100984959
(3aR,4S,7S,7aS)-7-hydroxy-2,2,4-trimethyl-3a,4,7,7a-tetrahydro-[1,3]dioxolo[4,5-c]pyran-6-one (PubChem CID 100984959) has the molecular formula C9H14O5 and a molecular weight of 202.21 g/mol. Its IUPAC name is (3aR,4S,7S,7aS)-7-hydroxy-2,2,4-trimethyl-3a,4,7,7a-tetrahydro-[1,3]dioxolo[4,5-c]pyran-6-one.
| Compound Name | (3aR,4S,7S,7aS)-7-hydroxy-2,2,4-trimethyl-3a,4,7,7a-tetrahydro-[1,3]dioxolo[4,5-c]pyran-6-one |
|---|---|
| PubChem CID | 100984959 |
| Molecular Formula | C9H14O5 |
| Molecular Weight | 202.21 g/mol |
| Exact Mass | 202.08 |
| IUPAC Name | (3aR,4S,7S,7aS)-7-hydroxy-2,2,4-trimethyl-3a,4,7,7a-tetrahydro-[1,3]dioxolo[4,5-c]pyran-6-one |
| SMILES | C[C@@H]1OC(=O)[C@@H](O)[C@@H]2OC(C)(C)O[C@@H]21 |
| InChI | InChI=1S/C9H14O5/c1-4-6-7(5(10)8(11)12-4)14-9(2,3)13-6/h4-7,10H,1-3H3/t4-,5-,6+,7-/m0/s1 |
| InChIKey | QFFYROCEYQPNMG-YTLHQDLWSA-N |
| XLogP | -0.19 |
| TPSA | 64.99 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | |
| Heavy Atoms | 14 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 202.21 |
| LogP ≤ 5 | -0.19 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |