About CID 100984976
CID 100984976 (PubChem CID 100984976) has the molecular formula C6H6BrNZn-
and a molecular weight of 237.41 g/mol.
Molecular Properties
| Compound Name | CID 100984976 |
| PubChem CID | 100984976 |
| Molecular Formula | C6H6BrNZn- |
| Molecular Weight | 237.41 g/mol |
| Exact Mass | 234.90 |
| IUPAC Name | — |
| SMILES | C=C1[CH]C=CC=N1.[Br-].[Zn] |
| InChI | InChI=1S/C6H6N.BrH.Zn/c1-6-4-2-3-5-7-6;;/h2-5H,1H2;1H;/p-1 |
| InChIKey | NSPAXVYYPVRVBS-UHFFFAOYSA-M |
| XLogP | -1.65 |
| TPSA | 12.36 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | |
| Heavy Atoms | 9 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 237.41 |
| LogP ≤ 5 | -1.65 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 1 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'heavy_metal', 'substructure': 'N/A'} |
|---|
Analyze CID 100984976 with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of CID 100984976?
The IUPAC name of CID 100984976 (CID 100984976) is not available.
What is the SMILES notation for CID 100984976?
The canonical SMILES for CID 100984976 is C=C1[CH]C=CC=N1.[Br-].[Zn].
What is the InChIKey of CID 100984976?
The InChIKey is NSPAXVYYPVRVBS-UHFFFAOYSA-M. The full InChI is InChI=1S/C6H6N.BrH.Zn/c1-6-4-2-3-5-7-6;;/h2-5H,1H2;1H;/p-1.
What are the key properties of CID 100984976?
CID 100984976 has a molecular weight of 237.41 g/mol, XLogP of -1.65, 0 rotatable bonds, 0 hydrogen bond donors, and 1 hydrogen bond acceptors.
Where does this data come from?
All data for CID 100984976 is sourced from PubChem (CID 100984976), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).