C19H28N2O3 — CID 100985148
tert-butyl (2S)-2-[(1R)-1-[benzyl(hydroxy)amino]prop-2-enyl]pyrrolidine-1-carboxylate (PubChem CID 100985148) has the molecular formula C19H28N2O3 and a molecular weight of 332.44 g/mol. Its IUPAC name is tert-butyl (2S)-2-[(1R)-1-[benzyl(hydroxy)amino]prop-2-enyl]pyrrolidine-1-carboxylate.
| Compound Name | tert-butyl (2S)-2-[(1R)-1-[benzyl(hydroxy)amino]prop-2-enyl]pyrrolidine-1-carboxylate |
|---|---|
| PubChem CID | 100985148 |
| Molecular Formula | C19H28N2O3 |
| Molecular Weight | 332.44 g/mol |
| Exact Mass | 332.21 |
| IUPAC Name | tert-butyl (2S)-2-[(1R)-1-[benzyl(hydroxy)amino]prop-2-enyl]pyrrolidine-1-carboxylate |
| SMILES | C=C[C@H]([C@@H]1CCCN1C(=O)OC(C)(C)C)N(O)Cc1ccccc1 |
| InChI | InChI=1S/C19H28N2O3/c1-5-16(21(23)14-15-10-7-6-8-11-15)17-12-9-13-20(17)18(22)24-19(2,3)4/h5-8,10-11,16-17,23H,1,9,12-14H2,2-4H3/t16-,17+/m1/s1 |
| InChIKey | ZUTLEPZDIYAUOA-SJORKVTESA-N |
| XLogP | 3.83 |
| TPSA | 53.01 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 24 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 332.44 |
| LogP ≤ 5 | 3.83 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|