C22H34N2O3Si — CID 100985153
tert-butyl (2S)-2-[(1R)-1-[benzyl(hydroxy)amino]-3-trimethylsilylprop-2-ynyl]pyrrolidine-1-carboxylate (PubChem CID 100985153) has the molecular formula C22H34N2O3Si and a molecular weight of 402.61 g/mol. Its IUPAC name is tert-butyl (2S)-2-[(1R)-1-[benzyl(hydroxy)amino]-3-trimethylsilylprop-2-ynyl]pyrrolidine-1-carboxylate.
| Compound Name | tert-butyl (2S)-2-[(1R)-1-[benzyl(hydroxy)amino]-3-trimethylsilylprop-2-ynyl]pyrrolidine-1-carboxylate |
|---|---|
| PubChem CID | 100985153 |
| Molecular Formula | C22H34N2O3Si |
| Molecular Weight | 402.61 g/mol |
| Exact Mass | 402.23 |
| IUPAC Name | tert-butyl (2S)-2-[(1R)-1-[benzyl(hydroxy)amino]-3-trimethylsilylprop-2-ynyl]pyrrolidine-1-carboxylate |
| SMILES | CC(C)(C)OC(=O)N1CCC[C@H]1[C@@H](C#C[Si](C)(C)C)N(O)Cc1ccccc1 |
| InChI | InChI=1S/C22H34N2O3Si/c1-22(2,3)27-21(25)23-15-10-13-19(23)20(14-16-28(4,5)6)24(26)17-18-11-8-7-9-12-18/h7-9,11-12,19-20,26H,10,13,15,17H2,1-6H3/t19-,20+/m0/s1 |
| InChIKey | MZQUSGBQAVWVCB-VQTJNVASSA-N |
| XLogP | 4.53 |
| TPSA | 53.01 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 28 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 402.61 |
| LogP ≤ 5 | 4.53 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'heavy_metal', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'}, {'alert_name': 'triple_bond', 'substructure': 'N/A'} |
|---|