C21H28N2O5 — CID 100985154
tert-butyl (2S)-2-[(1R)-1-[benzyl(hydroxy)amino]-4-methoxy-4-oxobut-2-ynyl]pyrrolidine-1-carboxylate (PubChem CID 100985154) has the molecular formula C21H28N2O5 and a molecular weight of 388.46 g/mol. Its IUPAC name is tert-butyl (2S)-2-[(1R)-1-[benzyl(hydroxy)amino]-4-methoxy-4-oxobut-2-ynyl]pyrrolidine-1-carboxylate.
| Compound Name | tert-butyl (2S)-2-[(1R)-1-[benzyl(hydroxy)amino]-4-methoxy-4-oxobut-2-ynyl]pyrrolidine-1-carboxylate |
|---|---|
| PubChem CID | 100985154 |
| Molecular Formula | C21H28N2O5 |
| Molecular Weight | 388.46 g/mol |
| Exact Mass | 388.20 |
| IUPAC Name | tert-butyl (2S)-2-[(1R)-1-[benzyl(hydroxy)amino]-4-methoxy-4-oxobut-2-ynyl]pyrrolidine-1-carboxylate |
| SMILES | COC(=O)C#C[C@H]([C@@H]1CCCN1C(=O)OC(C)(C)C)N(O)Cc1ccccc1 |
| InChI | InChI=1S/C21H28N2O5/c1-21(2,3)28-20(25)22-14-8-11-17(22)18(12-13-19(24)27-4)23(26)15-16-9-6-5-7-10-16/h5-7,9-10,17-18,26H,8,11,14-15H2,1-4H3/t17-,18+/m0/s1 |
| InChIKey | YFEUPWMOQRCZNA-ZWKOTPCHSA-N |
| XLogP | 2.82 |
| TPSA | 79.31 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 28 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 388.46 |
| LogP ≤ 5 | 2.82 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'Michael_acceptor_5', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'}, {'alert_name': 'triple_bond', 'substructure': 'N/A'} |
|---|