C26H26F3N3O6 — CID 10098578
3-[2,5-dioxo-4-phenyl-1-[3-[[7-propyl-3-(trifluoromethyl)-1,2-benzoxazol-6-yl]oxy]propyl]imidazolidin-4-yl]propanoic acid (PubChem CID 10098578) has the molecular formula C26H26F3N3O6 and a molecular weight of 533.50 g/mol. Its IUPAC name is 3-[2,5-dioxo-4-phenyl-1-[3-[[7-propyl-3-(trifluoromethyl)-1,2-benzoxazol-6-yl]oxy]propyl]imidazolidin-4-yl]propanoic acid.
| Compound Name | 3-[2,5-dioxo-4-phenyl-1-[3-[[7-propyl-3-(trifluoromethyl)-1,2-benzoxazol-6-yl]oxy]propyl]imidazolidin-4-yl]propanoic acid |
|---|---|
| PubChem CID | 10098578 |
| Molecular Formula | C26H26F3N3O6 |
| Molecular Weight | 533.50 g/mol |
| Exact Mass | 533.18 |
| IUPAC Name | 3-[2,5-dioxo-4-phenyl-1-[3-[[7-propyl-3-(trifluoromethyl)-1,2-benzoxazol-6-yl]oxy]propyl]imidazolidin-4-yl]propanoic acid |
| SMILES | CCCc1c(OCCCN2C(=O)NC(CCC(=O)O)(c3ccccc3)C2=O)ccc2c(C(F)(F)F)noc12 |
| InChI | InChI=1S/C26H26F3N3O6/c1-2-7-17-19(11-10-18-21(17)38-31-22(18)26(27,28)29)37-15-6-14-32-23(35)25(30-24(32)36,13-12-20(33)34)16-8-4-3-5-9-16/h3-5,8-11H,2,6-7,12-15H2,1H3,(H,30,36)(H,33,34) |
| InChIKey | FDDKBYWDHOWVNH-UHFFFAOYSA-N |
| XLogP | 4.88 |
| TPSA | 121.97 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 11 |
| Heavy Atoms | 38 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 533.50 |
| LogP ≤ 5 | 4.88 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'hydantoin', 'substructure': 'N/A'} |
|---|