C15H24O3 — CID 100985847
6a-methoxy-2',2',6-trimethylspiro[1,3,3a,4-tetrahydropentalene-2,5'-1,3-dioxane] (PubChem CID 100985847) has the molecular formula C15H24O3 and a molecular weight of 252.35 g/mol. Its IUPAC name is 6a-methoxy-2',2',6-trimethylspiro[1,3,3a,4-tetrahydropentalene-2,5'-1,3-dioxane].
| Compound Name | 6a-methoxy-2',2',6-trimethylspiro[1,3,3a,4-tetrahydropentalene-2,5'-1,3-dioxane] |
|---|---|
| PubChem CID | 100985847 |
| Molecular Formula | C15H24O3 |
| Molecular Weight | 252.35 g/mol |
| Exact Mass | 252.17 |
| IUPAC Name | 6a-methoxy-2',2',6-trimethylspiro[1,3,3a,4-tetrahydropentalene-2,5'-1,3-dioxane] |
| SMILES | COC12CC3(COC(C)(C)OC3)CC1CC=C2C |
| InChI | InChI=1S/C15H24O3/c1-11-5-6-12-7-14(8-15(11,12)16-4)9-17-13(2,3)18-10-14/h5,12H,6-10H2,1-4H3 |
| InChIKey | SZIHPSZTSNUJHU-UHFFFAOYSA-N |
| XLogP | 2.90 |
| TPSA | 27.69 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 18 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 252.35 |
| LogP ≤ 5 | 2.90 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|