C23H32N6O9 — CID 10098676
(2S)-5-amino-2-[[(2S)-2-[[(2S)-4-amino-2-[[(2S)-2-amino-3-phenylpropanoyl]amino]-4-oxobutanoyl]amino]-4-carboxybutanoyl]amino]-5-oxopentanoic acid (PubChem CID 10098676) has the molecular formula C23H32N6O9 and a molecular weight of 536.54 g/mol. Its IUPAC name is (2S)-5-amino-2-[[(2S)-2-[[(2S)-4-amino-2-[[(2S)-2-amino-3-phenylpropanoyl]amino]-4-oxobutanoyl]amino]-4-carboxybutanoyl]amino]-5-oxopentanoic acid.
| Compound Name | (2S)-5-amino-2-[[(2S)-2-[[(2S)-4-amino-2-[[(2S)-2-amino-3-phenylpropanoyl]amino]-4-oxobutanoyl]amino]-4-carboxybutanoyl]amino]-5-oxopentanoic acid |
|---|---|
| PubChem CID | 10098676 |
| Molecular Formula | C23H32N6O9 |
| Molecular Weight | 536.54 g/mol |
| Exact Mass | 536.22 |
| IUPAC Name | (2S)-5-amino-2-[[(2S)-2-[[(2S)-4-amino-2-[[(2S)-2-amino-3-phenylpropanoyl]amino]-4-oxobutanoyl]amino]-4-carboxybutanoyl]amino]-5-oxopentanoic acid |
| SMILES | NC(=O)CC[C@H](NC(=O)[C@H](CCC(=O)O)NC(=O)[C@H](CC(N)=O)NC(=O)[C@@H](N)Cc1ccccc1)C(=O)O |
| InChI | InChI=1S/C23H32N6O9/c24-13(10-12-4-2-1-3-5-12)20(34)29-16(11-18(26)31)22(36)27-14(7-9-19(32)33)21(35)28-15(23(37)38)6-8-17(25)30/h1-5,13-16H,6-11,24H2,(H2,25,30)(H2,26,31)(H,27,36)(H,28,35)(H,29,34)(H,32,33)(H,37,38)/t13-,14-,15-,16-/m0/s1 |
| InChIKey | HKUIECRCCZKYKV-VGWMRTNUSA-N |
| XLogP | -2.90 |
| TPSA | 274.10 Ų |
| H-Bond Donors | 8 |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 17 |
| Heavy Atoms | 38 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 536.54 |
| LogP ≤ 5 | -2.90 |
| H-Bond Donors ≤ 5 | 8 |
| H-Bond Acceptors ≤ 10 | 8 |