C20H28O7 — CID 100986780
[(E,4S)-1-acetyloxy-4-[(4S)-2,2-dimethyl-1,3-dioxolan-4-yl]-4-prop-2-enoxyoct-2-en-7-ynyl] acetate (PubChem CID 100986780) has the molecular formula C20H28O7 and a molecular weight of 380.44 g/mol. Its IUPAC name is [(E,4S)-1-acetyloxy-4-[(4S)-2,2-dimethyl-1,3-dioxolan-4-yl]-4-prop-2-enoxyoct-2-en-7-ynyl] acetate.
| Compound Name | [(E,4S)-1-acetyloxy-4-[(4S)-2,2-dimethyl-1,3-dioxolan-4-yl]-4-prop-2-enoxyoct-2-en-7-ynyl] acetate |
|---|---|
| PubChem CID | 100986780 |
| Molecular Formula | C20H28O7 |
| Molecular Weight | 380.44 g/mol |
| Exact Mass | 380.18 |
| IUPAC Name | [(E,4S)-1-acetyloxy-4-[(4S)-2,2-dimethyl-1,3-dioxolan-4-yl]-4-prop-2-enoxyoct-2-en-7-ynyl] acetate |
| SMILES | C#CCC[C@@](/C=C/C(OC(C)=O)OC(C)=O)(OCC=C)[C@@H]1COC(C)(C)O1 |
| InChI | InChI=1S/C20H28O7/c1-7-9-11-20(23-13-8-2,17-14-24-19(5,6)27-17)12-10-18(25-15(3)21)26-16(4)22/h1,8,10,12,17-18H,2,9,11,13-14H2,3-6H3/b12-10+/t17-,20-/m0/s1 |
| InChIKey | ZQVWCDRFGARRGG-NZDACYECSA-N |
| XLogP | 2.50 |
| TPSA | 80.29 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 10 |
| Heavy Atoms | 27 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 380.44 |
| LogP ≤ 5 | 2.50 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'het-C-het_not_in_ring', 'substructure': 'N/A'}, {'alert_name': 'isolated_alkene', 'substructure': 'N/A'}, {'alert_name': 'triple_bond', 'substructure': 'N/A'} |
|---|