C27H28N4O6S — CID 10098683
trans-(1R,2R)-1-N-[(4-nitrophenyl)methyl]-2-N-[[4-(2-sulfamoylphenyl)phenyl]methyl]cyclopentane-1,2-dicarboxamide (PubChem CID 10098683) has the molecular formula C27H28N4O6S and a molecular weight of 536.61 g/mol. Its IUPAC name is trans-(1R,2R)-1-N-[(4-nitrophenyl)methyl]-2-N-[[4-(2-sulfamoylphenyl)phenyl]methyl]cyclopentane-1,2-dicarboxamide.
| Compound Name | trans-(1R,2R)-1-N-[(4-nitrophenyl)methyl]-2-N-[[4-(2-sulfamoylphenyl)phenyl]methyl]cyclopentane-1,2-dicarboxamide |
|---|---|
| PubChem CID | 10098683 |
| Molecular Formula | C27H28N4O6S |
| Molecular Weight | 536.61 g/mol |
| Exact Mass | 536.17 |
| IUPAC Name | trans-(1R,2R)-1-N-[(4-nitrophenyl)methyl]-2-N-[[4-(2-sulfamoylphenyl)phenyl]methyl]cyclopentane-1,2-dicarboxamide |
| SMILES | NS(=O)(=O)c1ccccc1-c1ccc(CNC(=O)[C@@H]2CCC[C@H]2C(=O)NCc2ccc([N+](=O)[O-])cc2)cc1 |
| InChI | InChI=1S/C27H28N4O6S/c28-38(36,37)25-7-2-1-4-22(25)20-12-8-18(9-13-20)16-29-26(32)23-5-3-6-24(23)27(33)30-17-19-10-14-21(15-11-19)31(34)35/h1-2,4,7-15,23-24H,3,5-6,16-17H2,(H,29,32)(H,30,33)(H2,28,36,37)/t23-,24-/m1/s1 |
| InChIKey | HFVMFXRCNFZKMJ-DNQXCXABSA-N |
| XLogP | 3.26 |
| TPSA | 161.50 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 38 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 536.61 |
| LogP ≤ 5 | 3.26 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|