C23H35NO2 — CID 100986873
(3S,4R)-3-tert-butyl-1-(2,5-ditert-butylphenyl)-4-methylpyrrolidine-2,5-dione (PubChem CID 100986873) has the molecular formula C23H35NO2 and a molecular weight of 357.54 g/mol. Its IUPAC name is (3S,4R)-3-tert-butyl-1-(2,5-ditert-butylphenyl)-4-methylpyrrolidine-2,5-dione.
| Compound Name | (3S,4R)-3-tert-butyl-1-(2,5-ditert-butylphenyl)-4-methylpyrrolidine-2,5-dione |
|---|---|
| PubChem CID | 100986873 |
| Molecular Formula | C23H35NO2 |
| Molecular Weight | 357.54 g/mol |
| Exact Mass | 357.27 |
| IUPAC Name | (3S,4R)-3-tert-butyl-1-(2,5-ditert-butylphenyl)-4-methylpyrrolidine-2,5-dione |
| SMILES | C[C@H]1C(=O)N(c2cc(C(C)(C)C)ccc2C(C)(C)C)C(=O)[C@@H]1C(C)(C)C |
| InChI | InChI=1S/C23H35NO2/c1-14-18(23(8,9)10)20(26)24(19(14)25)17-13-15(21(2,3)4)11-12-16(17)22(5,6)7/h11-14,18H,1-10H3/t14-,18-/m1/s1 |
| InChIKey | PHIBCYDDEBBHRX-RDTXWAMCSA-N |
| XLogP | 5.45 |
| TPSA | 37.38 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 26 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 357.54 |
| LogP ≤ 5 | 5.45 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'phthalimide', 'substructure': 'N/A'} |
|---|