C38H40N4O10 — CID 100987240
tetramethyl 2,3-bis(4-methoxy-N-methylanilino)-1-methyl-8a-phenylimidazo[1,2-a]pyridine-5,6,7,8-tetracarboxylate (PubChem CID 100987240) has the molecular formula C38H40N4O10 and a molecular weight of 712.76 g/mol. Its IUPAC name is tetramethyl 2,3-bis(4-methoxy-N-methylanilino)-1-methyl-8a-phenylimidazo[1,2-a]pyridine-5,6,7,8-tetracarboxylate.
| Compound Name | tetramethyl 2,3-bis(4-methoxy-N-methylanilino)-1-methyl-8a-phenylimidazo[1,2-a]pyridine-5,6,7,8-tetracarboxylate |
|---|---|
| PubChem CID | 100987240 |
| Molecular Formula | C38H40N4O10 |
| Molecular Weight | 712.76 g/mol |
| Exact Mass | 712.27 |
| IUPAC Name | tetramethyl 2,3-bis(4-methoxy-N-methylanilino)-1-methyl-8a-phenylimidazo[1,2-a]pyridine-5,6,7,8-tetracarboxylate |
| SMILES | COC(=O)C1=C(C(=O)OC)N2C(N(C)c3ccc(OC)cc3)=C(N(C)c3ccc(OC)cc3)N(C)C2(c2ccccc2)C(C(=O)OC)=C1C(=O)OC |
| InChI | InChI=1S/C38H40N4O10/c1-39(24-15-19-26(47-4)20-16-24)32-33(40(2)25-17-21-27(48-5)22-18-25)42-31(37(46)52-9)29(35(44)50-7)28(34(43)49-6)30(36(45)51-8)38(42,41(32)3)23-13-11-10-12-14-23/h10-22H,1-9H3 |
| InChIKey | ZDGDPNCSUVOXJF-UHFFFAOYSA-N |
| XLogP | 3.76 |
| TPSA | 136.62 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 14 |
| Rotatable Bonds | 11 |
| Heavy Atoms | 52 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 712.76 |
| LogP ≤ 5 | 3.76 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 14 |
| Structural Alerts | {'alert_name': '>_2_ester_groups', 'substructure': 'N/A'} |
|---|