C12H24N4 — CID 100987522
(1S,3R,5S,7R,9S,11R)-3,7,11-trimethyl-2,6,10,13-tetrazatricyclo[7.3.1.05,13]tridecane (PubChem CID 100987522) has the molecular formula C12H24N4 and a molecular weight of 224.35 g/mol. Its IUPAC name is (1S,3R,5S,7R,9S,11R)-3,7,11-trimethyl-2,6,10,13-tetrazatricyclo[7.3.1.05,13]tridecane.
| Compound Name | (1S,3R,5S,7R,9S,11R)-3,7,11-trimethyl-2,6,10,13-tetrazatricyclo[7.3.1.05,13]tridecane |
|---|---|
| PubChem CID | 100987522 |
| Molecular Formula | C12H24N4 |
| Molecular Weight | 224.35 g/mol |
| Exact Mass | 224.20 |
| IUPAC Name | (1S,3R,5S,7R,9S,11R)-3,7,11-trimethyl-2,6,10,13-tetrazatricyclo[7.3.1.05,13]tridecane |
| SMILES | C[C@@H]1C[C@H]2N[C@H](C)C[C@H]3N[C@H](C)C[C@@H](N1)N32 |
| InChI | InChI=1S/C12H24N4/c1-7-4-10-14-9(3)6-12-15-8(2)5-11(13-7)16(10)12/h7-15H,4-6H2,1-3H3/t7-,8-,9-,10+,11+,12+/m1/s1 |
| InChIKey | MZEWYVRDJISVSS-UCFKJQRDSA-N |
| XLogP | 0.41 |
| TPSA | 39.33 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | |
| Heavy Atoms | 16 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 224.35 |
| LogP ≤ 5 | 0.41 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 4 |