C30H44N2O5Si — CID 10098811
N'-tert-butyl-3-[[tert-butyl(dimethyl)silyl]oxymethyl]-N'-(3,5-dimethylbenzoyl)-5-methyl-2,3-dihydro-1,4-benzodioxine-6-carbohydrazide (PubChem CID 10098811) has the molecular formula C30H44N2O5Si and a molecular weight of 540.78 g/mol. Its IUPAC name is N'-tert-butyl-3-[[tert-butyl(dimethyl)silyl]oxymethyl]-N'-(3,5-dimethylbenzoyl)-5-methyl-2,3-dihydro-1,4-benzodioxine-6-carbohydrazide.
| Compound Name | N'-tert-butyl-3-[[tert-butyl(dimethyl)silyl]oxymethyl]-N'-(3,5-dimethylbenzoyl)-5-methyl-2,3-dihydro-1,4-benzodioxine-6-carbohydrazide |
|---|---|
| PubChem CID | 10098811 |
| Molecular Formula | C30H44N2O5Si |
| Molecular Weight | 540.78 g/mol |
| Exact Mass | 540.30 |
| IUPAC Name | N'-tert-butyl-3-[[tert-butyl(dimethyl)silyl]oxymethyl]-N'-(3,5-dimethylbenzoyl)-5-methyl-2,3-dihydro-1,4-benzodioxine-6-carbohydrazide |
| SMILES | Cc1cc(C)cc(C(=O)N(NC(=O)c2ccc3c(c2C)OC(CO[Si](C)(C)C(C)(C)C)CO3)C(C)(C)C)c1 |
| InChI | InChI=1S/C30H44N2O5Si/c1-19-14-20(2)16-22(15-19)28(34)32(29(4,5)6)31-27(33)24-12-13-25-26(21(24)3)37-23(17-35-25)18-36-38(10,11)30(7,8)9/h12-16,23H,17-18H2,1-11H3,(H,31,33) |
| InChIKey | LOUVHVOLIHCWGR-UHFFFAOYSA-N |
| XLogP | 6.36 |
| TPSA | 77.10 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 38 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 540.78 |
| LogP ≤ 5 | 6.36 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'heavy_metal', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|