C19H24F13NSi — CID 10098816
tri(propan-2-yl)-[2-(1,1,2,2,3,3,4,4,5,5,6,6,6-tridecafluorohexyl)pyrrol-1-yl]silane (PubChem CID 10098816) has the molecular formula C19H24F13NSi and a molecular weight of 541.47 g/mol. Its IUPAC name is tri(propan-2-yl)-[2-(1,1,2,2,3,3,4,4,5,5,6,6,6-tridecafluorohexyl)pyrrol-1-yl]silane.
| Compound Name | tri(propan-2-yl)-[2-(1,1,2,2,3,3,4,4,5,5,6,6,6-tridecafluorohexyl)pyrrol-1-yl]silane |
|---|---|
| PubChem CID | 10098816 |
| Molecular Formula | C19H24F13NSi |
| Molecular Weight | 541.47 g/mol |
| Exact Mass | 541.15 |
| IUPAC Name | tri(propan-2-yl)-[2-(1,1,2,2,3,3,4,4,5,5,6,6,6-tridecafluorohexyl)pyrrol-1-yl]silane |
| SMILES | CC(C)[Si](C(C)C)(C(C)C)n1cccc1C(F)(F)C(F)(F)C(F)(F)C(F)(F)C(F)(F)C(F)(F)F |
| InChI | InChI=1S/C19H24F13NSi/c1-10(2)34(11(3)4,12(5)6)33-9-7-8-13(33)14(20,21)15(22,23)16(24,25)17(26,27)18(28,29)19(30,31)32/h7-12H,1-6H3 |
| InChIKey | BBKKONURXBNNKV-UHFFFAOYSA-N |
| XLogP | 8.71 |
| TPSA | 4.93 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 34 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 541.47 |
| LogP ≤ 5 | 8.71 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 1 |
| Structural Alerts | {'alert_name': 'heavy_metal', 'substructure': 'N/A'}, {'alert_name': 'Perfluorinated_chain', 'substructure': 'N/A'} |
|---|