methyl 2-[nitroso(pyridin-2-yl)amino]acetate

C8H9N3O3 — CID 100988337

IUPACmethyl 2-[nitroso(pyridin-2-yl)amino]acetate
SMILESCOC(=O)CN(N=O)c1ccccn1
InChIInChI=1S/C8H9N3O3/c1-14-8(12)6-11(10-13)7-4-2-3-5-9-7/h2-5H,6H2,1H3
InChIKeyCJDLZHFCGMCVHO-UHFFFAOYSA-N
MW195.18 g/mol
LogP0.74
Rot. Bonds4

About methyl 2-[nitroso(pyridin-2-yl)amino]acetate

methyl 2-[nitroso(pyridin-2-yl)amino]acetate (PubChem CID 100988337) has the molecular formula C8H9N3O3 and a molecular weight of 195.18 g/mol. Its IUPAC name is methyl 2-[nitroso(pyridin-2-yl)amino]acetate.

Molecular Properties

Compound Namemethyl 2-[nitroso(pyridin-2-yl)amino]acetate
PubChem CID100988337
Molecular FormulaC8H9N3O3
Molecular Weight195.18 g/mol
Exact Mass195.06
IUPAC Namemethyl 2-[nitroso(pyridin-2-yl)amino]acetate
SMILESCOC(=O)CN(N=O)c1ccccn1
InChIInChI=1S/C8H9N3O3/c1-14-8(12)6-11(10-13)7-4-2-3-5-9-7/h2-5H,6H2,1H3
InChIKeyCJDLZHFCGMCVHO-UHFFFAOYSA-N
XLogP0.74
TPSA71.86 Ų
H-Bond Donors
H-Bond Acceptors5
Rotatable Bonds4
Heavy Atoms14
Complexity

Lipinski Rule of Five

Passes Rule of Five

RuleValue
MW ≤ 500195.18
LogP ≤ 50.74
H-Bond Donors ≤ 50
H-Bond Acceptors ≤ 105

Computed Properties (RDKit)

Structural Alerts{'alert_name': 'N-nitroso', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'}

Analyze methyl 2-[nitroso(pyridin-2-yl)amino]acetate with MolForge

Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.

Launch Full Analysis

Frequently Asked Questions

What is the IUPAC name of methyl 2-[nitroso(pyridin-2-yl)amino]acetate?
The IUPAC name of methyl 2-[nitroso(pyridin-2-yl)amino]acetate (CID 100988337) is methyl 2-[nitroso(pyridin-2-yl)amino]acetate.
What is the SMILES notation for methyl 2-[nitroso(pyridin-2-yl)amino]acetate?
The canonical SMILES for methyl 2-[nitroso(pyridin-2-yl)amino]acetate is COC(=O)CN(N=O)c1ccccn1.
What is the InChIKey of methyl 2-[nitroso(pyridin-2-yl)amino]acetate?
The InChIKey is CJDLZHFCGMCVHO-UHFFFAOYSA-N. The full InChI is InChI=1S/C8H9N3O3/c1-14-8(12)6-11(10-13)7-4-2-3-5-9-7/h2-5H,6H2,1H3.
What are the key properties of methyl 2-[nitroso(pyridin-2-yl)amino]acetate?
methyl 2-[nitroso(pyridin-2-yl)amino]acetate has a molecular weight of 195.18 g/mol, XLogP of 0.74, 4 rotatable bonds, 0 hydrogen bond donors, and 5 hydrogen bond acceptors.
Where does this data come from?
All data for methyl 2-[nitroso(pyridin-2-yl)amino]acetate is sourced from PubChem (CID 100988337), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).