C8H8F6NNaO2 — CID 100988571
sodium (Z)-1,1,1,5,5,5-hexafluoro-4-(2-methoxyethylimino)pent-2-en-2-olate (PubChem CID 100988571) has the molecular formula C8H8F6NNaO2 and a molecular weight of 287.14 g/mol. Its IUPAC name is sodium (Z)-1,1,1,5,5,5-hexafluoro-4-(2-methoxyethylimino)pent-2-en-2-olate.
| Compound Name | sodium (Z)-1,1,1,5,5,5-hexafluoro-4-(2-methoxyethylimino)pent-2-en-2-olate |
|---|---|
| PubChem CID | 100988571 |
| Molecular Formula | C8H8F6NNaO2 |
| Molecular Weight | 287.14 g/mol |
| Exact Mass | 287.04 |
| IUPAC Name | sodium (Z)-1,1,1,5,5,5-hexafluoro-4-(2-methoxyethylimino)pent-2-en-2-olate |
| SMILES | COCC/N=C(\C=C(/[O-])C(F)(F)F)C(F)(F)F.[Na+] |
| InChI | InChI=1S/C8H9F6NO2.Na/c1-17-3-2-15-5(7(9,10)11)4-6(16)8(12,13)14;/h4,16H,2-3H2,1H3;/q;+1/p-1/b6-4-,15-5+; |
| InChIKey | KYTMSBOSPRPPKA-XNDXWMNFSA-M |
| XLogP | -1.55 |
| TPSA | 44.65 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 18 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 287.14 |
| LogP ≤ 5 | -1.55 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'acyclic_C=C-O', 'substructure': 'N/A'}, {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'imine_1', 'substructure': 'N/A'} |
|---|