About [3-[dimethyl-[3-(trifluoromethyl)phenyl]silyl]-2,2-dimethylpropyl] 4-methylbenzenesulfonate
[3-[dimethyl-[3-(trifluoromethyl)phenyl]silyl]-2,2-dimethylpropyl] 4-methylbenzenesulfonate (PubChem CID 100988701) has the molecular formula C21H27F3O3SSi
and a molecular weight of 444.59 g/mol. Its IUPAC name is [3-[dimethyl-[3-(trifluoromethyl)phenyl]silyl]-2,2-dimethylpropyl] 4-methylbenzenesulfonate.
Molecular Properties
| Compound Name | [3-[dimethyl-[3-(trifluoromethyl)phenyl]silyl]-2,2-dimethylpropyl] 4-methylbenzenesulfonate |
| PubChem CID | 100988701 |
| Molecular Formula | C21H27F3O3SSi |
| Molecular Weight | 444.59 g/mol |
| Exact Mass | 444.14 |
| IUPAC Name | [3-[dimethyl-[3-(trifluoromethyl)phenyl]silyl]-2,2-dimethylpropyl] 4-methylbenzenesulfonate |
| SMILES | Cc1ccc(S(=O)(=O)OCC(C)(C)C[Si](C)(C)c2cccc(C(F)(F)F)c2)cc1 |
| InChI | InChI=1S/C21H27F3O3SSi/c1-16-9-11-18(12-10-16)28(25,26)27-14-20(2,3)15-29(4,5)19-8-6-7-17(13-19)21(22,23)24/h6-13H,14-15H2,1-5H3 |
| InChIKey | DHGDBKJPSUHUDJ-UHFFFAOYSA-N |
| XLogP | 5.36 |
| TPSA | 43.37 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 29 |
| Complexity | — |
Lipinski Rule of Five
1 violation
| Rule | Value |
| MW ≤ 500 | 444.59 |
| LogP ≤ 5 | 5.36 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'heavy_metal', 'substructure': 'N/A'}, {'alert_name': 'Sulfonic_acid_1', 'substructure': 'N/A'} |
|---|
Analyze [3-[dimethyl-[3-(trifluoromethyl)phenyl]silyl]-2,2-dimethylpropyl] 4-methylbenzenesulfonate with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of [3-[dimethyl-[3-(trifluoromethyl)phenyl]silyl]-2,2-dimethylpropyl] 4-methylbenzenesulfonate?
The IUPAC name of [3-[dimethyl-[3-(trifluoromethyl)phenyl]silyl]-2,2-dimethylpropyl] 4-methylbenzenesulfonate (CID 100988701) is [3-[dimethyl-[3-(trifluoromethyl)phenyl]silyl]-2,2-dimethylpropyl] 4-methylbenzenesulfonate.
What is the SMILES notation for [3-[dimethyl-[3-(trifluoromethyl)phenyl]silyl]-2,2-dimethylpropyl] 4-methylbenzenesulfonate?
The canonical SMILES for [3-[dimethyl-[3-(trifluoromethyl)phenyl]silyl]-2,2-dimethylpropyl] 4-methylbenzenesulfonate is Cc1ccc(S(=O)(=O)OCC(C)(C)C[Si](C)(C)c2cccc(C(F)(F)F)c2)cc1.
What is the InChIKey of [3-[dimethyl-[3-(trifluoromethyl)phenyl]silyl]-2,2-dimethylpropyl] 4-methylbenzenesulfonate?
The InChIKey is DHGDBKJPSUHUDJ-UHFFFAOYSA-N. The full InChI is InChI=1S/C21H27F3O3SSi/c1-16-9-11-18(12-10-16)28(25,26)27-14-20(2,3)15-29(4,5)19-8-6-7-17(13-19)21(22,23)24/h6-13H,14-15H2,1-5H3.
What are the key properties of [3-[dimethyl-[3-(trifluoromethyl)phenyl]silyl]-2,2-dimethylpropyl] 4-methylbenzenesulfonate?
[3-[dimethyl-[3-(trifluoromethyl)phenyl]silyl]-2,2-dimethylpropyl] 4-methylbenzenesulfonate has a molecular weight of 444.59 g/mol, XLogP of 5.36, 7 rotatable bonds, 0 hydrogen bond donors, and 3 hydrogen bond acceptors.
Where does this data come from?
All data for [3-[dimethyl-[3-(trifluoromethyl)phenyl]silyl]-2,2-dimethylpropyl] 4-methylbenzenesulfonate is sourced from PubChem (CID 100988701), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).