C25H20Cl2FN5O2S — CID 10098903
6-[2-(2,6-dichlorophenyl)-5-(4-fluorophenyl)-1H-imidazol-4-yl]-1-propan-2-ylsulfonylbenzimidazol-2-amine (PubChem CID 10098903) has the molecular formula C25H20Cl2FN5O2S and a molecular weight of 544.44 g/mol. Its IUPAC name is 6-[2-(2,6-dichlorophenyl)-5-(4-fluorophenyl)-1H-imidazol-4-yl]-1-propan-2-ylsulfonylbenzimidazol-2-amine.
| Compound Name | 6-[2-(2,6-dichlorophenyl)-5-(4-fluorophenyl)-1H-imidazol-4-yl]-1-propan-2-ylsulfonylbenzimidazol-2-amine |
|---|---|
| PubChem CID | 10098903 |
| Molecular Formula | C25H20Cl2FN5O2S |
| Molecular Weight | 544.44 g/mol |
| Exact Mass | 543.07 |
| IUPAC Name | 6-[2-(2,6-dichlorophenyl)-5-(4-fluorophenyl)-1H-imidazol-4-yl]-1-propan-2-ylsulfonylbenzimidazol-2-amine |
| SMILES | CC(C)S(=O)(=O)n1c(N)nc2ccc(-c3nc(-c4c(Cl)cccc4Cl)[nH]c3-c3ccc(F)cc3)cc21 |
| InChI | InChI=1S/C25H20Cl2FN5O2S/c1-13(2)36(34,35)33-20-12-15(8-11-19(20)30-25(33)29)23-22(14-6-9-16(28)10-7-14)31-24(32-23)21-17(26)4-3-5-18(21)27/h3-13H,1-2H3,(H2,29,30)(H,31,32) |
| InChIKey | UWFZITVNSLTPGK-UHFFFAOYSA-N |
| XLogP | 6.37 |
| TPSA | 106.66 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 36 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 544.44 |
| LogP ≤ 5 | 6.37 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'imidazole_A(19)', 'substructure': 'N/A'} |
|---|