C34H57FO2Si — CID 10098922
ethyl (4E,8E,12Z,16E)-12-fluoro-4,8,13,16,19,19-hexamethyl-23-trimethylsilyltricosa-4,8,12,16-tetraen-21-ynoate (PubChem CID 10098922) has the molecular formula C34H57FO2Si and a molecular weight of 544.91 g/mol. Its IUPAC name is ethyl (4E,8E,12Z,16E)-12-fluoro-4,8,13,16,19,19-hexamethyl-23-trimethylsilyltricosa-4,8,12,16-tetraen-21-ynoate.
| Compound Name | ethyl (4E,8E,12Z,16E)-12-fluoro-4,8,13,16,19,19-hexamethyl-23-trimethylsilyltricosa-4,8,12,16-tetraen-21-ynoate |
|---|---|
| PubChem CID | 10098922 |
| Molecular Formula | C34H57FO2Si |
| Molecular Weight | 544.91 g/mol |
| Exact Mass | 544.41 |
| IUPAC Name | ethyl (4E,8E,12Z,16E)-12-fluoro-4,8,13,16,19,19-hexamethyl-23-trimethylsilyltricosa-4,8,12,16-tetraen-21-ynoate |
| SMILES | CCOC(=O)CC/C(C)=C/CC/C(C)=C/CC/C(F)=C(\C)CC/C(C)=C/CC(C)(C)CC#CC[Si](C)(C)C |
| InChI | InChI=1S/C34H57FO2Si/c1-11-37-33(36)23-21-29(3)17-14-16-28(2)18-15-19-32(35)31(5)22-20-30(4)24-26-34(6,7)25-12-13-27-38(8,9)10/h17-18,24H,11,14-16,19-23,25-27H2,1-10H3/b28-18+,29-17+,30-24+,32-31- |
| InChIKey | NTBVALIQYQHYJU-DDGXPDBQSA-N |
| XLogP | 10.90 |
| TPSA | 26.30 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 17 |
| Heavy Atoms | 38 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 544.91 |
| LogP ≤ 5 | 10.90 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'heavy_metal', 'substructure': 'N/A'}, {'alert_name': 'isolated_alkene', 'substructure': 'N/A'}, {'alert_name': 'triple_bond', 'substructure': 'N/A'} |
|---|