C24H26F5N3O4S — CID 10098988
1-cyclopropyl-N-hydroxy-4-[4-[5-(3,3,4,4,4-pentafluorobutyl)-2-pyridinyl]phenyl]sulfonylpiperidine-4-carboxamide (PubChem CID 10098988) has the molecular formula C24H26F5N3O4S and a molecular weight of 547.55 g/mol. Its IUPAC name is 1-cyclopropyl-N-hydroxy-4-[4-[5-(3,3,4,4,4-pentafluorobutyl)-2-pyridinyl]phenyl]sulfonylpiperidine-4-carboxamide.
| Compound Name | 1-cyclopropyl-N-hydroxy-4-[4-[5-(3,3,4,4,4-pentafluorobutyl)-2-pyridinyl]phenyl]sulfonylpiperidine-4-carboxamide |
|---|---|
| PubChem CID | 10098988 |
| Molecular Formula | C24H26F5N3O4S |
| Molecular Weight | 547.55 g/mol |
| Exact Mass | 547.16 |
| IUPAC Name | 1-cyclopropyl-N-hydroxy-4-[4-[5-(3,3,4,4,4-pentafluorobutyl)-2-pyridinyl]phenyl]sulfonylpiperidine-4-carboxamide |
| SMILES | O=C(NO)C1(S(=O)(=O)c2ccc(-c3ccc(CCC(F)(F)C(F)(F)F)cn3)cc2)CCN(C2CC2)CC1 |
| InChI | InChI=1S/C24H26F5N3O4S/c25-23(26,24(27,28)29)10-9-16-1-8-20(30-15-16)17-2-6-19(7-3-17)37(35,36)22(21(33)31-34)11-13-32(14-12-22)18-4-5-18/h1-3,6-8,15,18,34H,4-5,9-14H2,(H,31,33) |
| InChIKey | NGSBGNHQFDLFQR-UHFFFAOYSA-N |
| XLogP | 4.15 |
| TPSA | 99.60 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 37 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 547.55 |
| LogP ≤ 5 | 4.15 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'hydroxamic_acid', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'}, {'alert_name': 'Perfluorinated_chain', 'substructure': 'N/A'} |
|---|