About 6-(hydrazinylmethyl)-2,3-dihydrophthalazine-1,4-dione
6-(hydrazinylmethyl)-2,3-dihydrophthalazine-1,4-dione (PubChem CID 100989975) has the molecular formula C9H10N4O2
and a molecular weight of 206.21 g/mol. Its IUPAC name is 6-(hydrazinylmethyl)-2,3-dihydrophthalazine-1,4-dione.
Molecular Properties
| Compound Name | 6-(hydrazinylmethyl)-2,3-dihydrophthalazine-1,4-dione |
| PubChem CID | 100989975 |
| Molecular Formula | C9H10N4O2 |
| Molecular Weight | 206.21 g/mol |
| Exact Mass | 206.08 |
| IUPAC Name | 6-(hydrazinylmethyl)-2,3-dihydrophthalazine-1,4-dione |
| SMILES | NNCc1ccc2c(=O)[nH][nH]c(=O)c2c1 |
| InChI | InChI=1S/C9H10N4O2/c10-11-4-5-1-2-6-7(3-5)9(15)13-12-8(6)14/h1-3,11H,4,10H2,(H,12,14)(H,13,15) |
| InChIKey | DPPXUNDZLAPHJE-UHFFFAOYSA-N |
| XLogP | -0.82 |
| TPSA | 103.77 Ų |
| H-Bond Donors | 4 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 15 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 206.21 |
| LogP ≤ 5 | -0.82 |
| H-Bond Donors ≤ 5 | 4 |
| H-Bond Acceptors ≤ 10 | 4 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'hydrazine', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|
Analyze 6-(hydrazinylmethyl)-2,3-dihydrophthalazine-1,4-dione with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 6-(hydrazinylmethyl)-2,3-dihydrophthalazine-1,4-dione?
The IUPAC name of 6-(hydrazinylmethyl)-2,3-dihydrophthalazine-1,4-dione (CID 100989975) is 6-(hydrazinylmethyl)-2,3-dihydrophthalazine-1,4-dione.
What is the SMILES notation for 6-(hydrazinylmethyl)-2,3-dihydrophthalazine-1,4-dione?
The canonical SMILES for 6-(hydrazinylmethyl)-2,3-dihydrophthalazine-1,4-dione is NNCc1ccc2c(=O)[nH][nH]c(=O)c2c1.
What is the InChIKey of 6-(hydrazinylmethyl)-2,3-dihydrophthalazine-1,4-dione?
The InChIKey is DPPXUNDZLAPHJE-UHFFFAOYSA-N. The full InChI is InChI=1S/C9H10N4O2/c10-11-4-5-1-2-6-7(3-5)9(15)13-12-8(6)14/h1-3,11H,4,10H2,(H,12,14)(H,13,15).
What are the key properties of 6-(hydrazinylmethyl)-2,3-dihydrophthalazine-1,4-dione?
6-(hydrazinylmethyl)-2,3-dihydrophthalazine-1,4-dione has a molecular weight of 206.21 g/mol, XLogP of -0.82, 2 rotatable bonds, 4 hydrogen bond donors, and 4 hydrogen bond acceptors.
Where does this data come from?
All data for 6-(hydrazinylmethyl)-2,3-dihydrophthalazine-1,4-dione is sourced from PubChem (CID 100989975), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).