C27H28F6N2O — CID 100990177
4-[methoxy-(3-methylphenyl)-[4-[methyl(2,2,2-trifluoroethyl)amino]phenyl]methyl]-N-methyl-N-(2,2,2-trifluoroethyl)aniline (PubChem CID 100990177) has the molecular formula C27H28F6N2O and a molecular weight of 510.52 g/mol. Its IUPAC name is 4-[methoxy-(3-methylphenyl)-[4-[methyl(2,2,2-trifluoroethyl)amino]phenyl]methyl]-N-methyl-N-(2,2,2-trifluoroethyl)aniline.
| Compound Name | 4-[methoxy-(3-methylphenyl)-[4-[methyl(2,2,2-trifluoroethyl)amino]phenyl]methyl]-N-methyl-N-(2,2,2-trifluoroethyl)aniline |
|---|---|
| PubChem CID | 100990177 |
| Molecular Formula | C27H28F6N2O |
| Molecular Weight | 510.52 g/mol |
| Exact Mass | 510.21 |
| IUPAC Name | 4-[methoxy-(3-methylphenyl)-[4-[methyl(2,2,2-trifluoroethyl)amino]phenyl]methyl]-N-methyl-N-(2,2,2-trifluoroethyl)aniline |
| SMILES | COC(c1ccc(N(C)CC(F)(F)F)cc1)(c1ccc(N(C)CC(F)(F)F)cc1)c1cccc(C)c1 |
| InChI | InChI=1S/C27H28F6N2O/c1-19-6-5-7-22(16-19)27(36-4,20-8-12-23(13-9-20)34(2)17-25(28,29)30)21-10-14-24(15-11-21)35(3)18-26(31,32)33/h5-16H,17-18H2,1-4H3 |
| InChIKey | ZBRBJHZLOZFUBI-UHFFFAOYSA-N |
| XLogP | 6.93 |
| TPSA | 15.71 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 36 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 510.52 |
| LogP ≤ 5 | 6.93 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'anil_di_alk_F(14)', 'substructure': 'N/A'}, {'alert_name': 'triphenyl_methyl-silyl', 'substructure': 'N/A'} |
|---|