C9H19NO — CID 100990327
trans-(1S,2S)-2-(propylaminomethyl)cyclopentan-1-ol (PubChem CID 100990327) has the molecular formula C9H19NO and a molecular weight of 157.26 g/mol. Its IUPAC name is trans-(1S,2S)-2-(propylaminomethyl)cyclopentan-1-ol.
| Compound Name | trans-(1S,2S)-2-(propylaminomethyl)cyclopentan-1-ol |
|---|---|
| PubChem CID | 100990327 |
| Molecular Formula | C9H19NO |
| Molecular Weight | 157.26 g/mol |
| Exact Mass | 157.15 |
| IUPAC Name | trans-(1S,2S)-2-(propylaminomethyl)cyclopentan-1-ol |
| SMILES | CCCNC[C@@H]1CCC[C@@H]1O |
| InChI | InChI=1S/C9H19NO/c1-2-6-10-7-8-4-3-5-9(8)11/h8-11H,2-7H2,1H3/t8-,9-/m0/s1 |
| InChIKey | QBNFJRHVMVALCR-IUCAKERBSA-N |
| XLogP | 1.15 |
| TPSA | 32.26 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 11 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 157.26 |
| LogP ≤ 5 | 1.15 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|