C28H31N5O5S — CID 10099038
2-[(1-aminoisoquinolin-6-yl)amino]-N-(3-aminophenyl)sulfonyl-2-(3-ethoxy-4-propan-2-yloxyphenyl)acetamide (PubChem CID 10099038) has the molecular formula C28H31N5O5S and a molecular weight of 549.65 g/mol. Its IUPAC name is 2-[(1-aminoisoquinolin-6-yl)amino]-N-(3-aminophenyl)sulfonyl-2-(3-ethoxy-4-propan-2-yloxyphenyl)acetamide.
| Compound Name | 2-[(1-aminoisoquinolin-6-yl)amino]-N-(3-aminophenyl)sulfonyl-2-(3-ethoxy-4-propan-2-yloxyphenyl)acetamide |
|---|---|
| PubChem CID | 10099038 |
| Molecular Formula | C28H31N5O5S |
| Molecular Weight | 549.65 g/mol |
| Exact Mass | 549.20 |
| IUPAC Name | 2-[(1-aminoisoquinolin-6-yl)amino]-N-(3-aminophenyl)sulfonyl-2-(3-ethoxy-4-propan-2-yloxyphenyl)acetamide |
| SMILES | CCOc1cc(C(Nc2ccc3c(N)nccc3c2)C(=O)NS(=O)(=O)c2cccc(N)c2)ccc1OC(C)C |
| InChI | InChI=1S/C28H31N5O5S/c1-4-37-25-15-19(8-11-24(25)38-17(2)3)26(28(34)33-39(35,36)22-7-5-6-20(29)16-22)32-21-9-10-23-18(14-21)12-13-31-27(23)30/h5-17,26,32H,4,29H2,1-3H3,(H2,30,31)(H,33,34) |
| InChIKey | XGRVTTDWPRPYFC-UHFFFAOYSA-N |
| XLogP | 4.24 |
| TPSA | 158.66 Ų |
| H-Bond Donors | 4 |
| H-Bond Acceptors | 9 |
| Rotatable Bonds | 10 |
| Heavy Atoms | 39 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 549.65 |
| LogP ≤ 5 | 4.24 |
| H-Bond Donors ≤ 5 | 4 |
| H-Bond Acceptors ≤ 10 | 9 |
| Structural Alerts | {'alert_name': 'aniline', 'substructure': 'N/A'} |
|---|