About methyl [bis(methoxycarbonyl)-(phenylhydrazinylidene)-λ5-phosphanyl]formate
methyl [bis(methoxycarbonyl)-(phenylhydrazinylidene)-λ5-phosphanyl]formate (PubChem CID 100991454) has the molecular formula C12H15N2O6P
and a molecular weight of 314.23 g/mol. Its IUPAC name is methyl [bis(methoxycarbonyl)-(phenylhydrazinylidene)-λ5-phosphanyl]formate.
Molecular Properties
| Compound Name | methyl [bis(methoxycarbonyl)-(phenylhydrazinylidene)-λ5-phosphanyl]formate |
| PubChem CID | 100991454 |
| Molecular Formula | C12H15N2O6P |
| Molecular Weight | 314.23 g/mol |
| Exact Mass | 314.07 |
| IUPAC Name | methyl [bis(methoxycarbonyl)-(phenylhydrazinylidene)-λ5-phosphanyl]formate |
| SMILES | COC(=O)P(=NNc1ccccc1)(C(=O)OC)C(=O)OC |
| InChI | InChI=1S/C12H15N2O6P/c1-18-10(15)21(11(16)19-2,12(17)20-3)14-13-9-7-5-4-6-8-9/h4-8,13H,1-3H3 |
| InChIKey | BUAMUFFZFQLESP-UHFFFAOYSA-N |
| XLogP | 3.51 |
| TPSA | 103.29 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 21 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 314.23 |
| LogP ≤ 5 | 3.51 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 7 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': '>_2_ester_groups', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'}, {'alert_name': 'phosphor', 'substructure': 'N/A'} |
|---|
Analyze methyl [bis(methoxycarbonyl)-(phenylhydrazinylidene)-λ5-phosphanyl]formate with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of methyl [bis(methoxycarbonyl)-(phenylhydrazinylidene)-λ5-phosphanyl]formate?
The IUPAC name of methyl [bis(methoxycarbonyl)-(phenylhydrazinylidene)-λ5-phosphanyl]formate (CID 100991454) is methyl [bis(methoxycarbonyl)-(phenylhydrazinylidene)-λ5-phosphanyl]formate.
What is the SMILES notation for methyl [bis(methoxycarbonyl)-(phenylhydrazinylidene)-λ5-phosphanyl]formate?
The canonical SMILES for methyl [bis(methoxycarbonyl)-(phenylhydrazinylidene)-λ5-phosphanyl]formate is COC(=O)P(=NNc1ccccc1)(C(=O)OC)C(=O)OC.
What is the InChIKey of methyl [bis(methoxycarbonyl)-(phenylhydrazinylidene)-λ5-phosphanyl]formate?
The InChIKey is BUAMUFFZFQLESP-UHFFFAOYSA-N. The full InChI is InChI=1S/C12H15N2O6P/c1-18-10(15)21(11(16)19-2,12(17)20-3)14-13-9-7-5-4-6-8-9/h4-8,13H,1-3H3.
What are the key properties of methyl [bis(methoxycarbonyl)-(phenylhydrazinylidene)-λ5-phosphanyl]formate?
methyl [bis(methoxycarbonyl)-(phenylhydrazinylidene)-λ5-phosphanyl]formate has a molecular weight of 314.23 g/mol, XLogP of 3.51, 5 rotatable bonds, 1 hydrogen bond donors, and 7 hydrogen bond acceptors.
Where does this data come from?
All data for methyl [bis(methoxycarbonyl)-(phenylhydrazinylidene)-λ5-phosphanyl]formate is sourced from PubChem (CID 100991454), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).