About 9-deuterio-9,10-dihydroacridine
9-deuterio-9,10-dihydroacridine (PubChem CID 100991515) has the molecular formula C13H11N
and a molecular weight of 182.24 g/mol. Its IUPAC name is 9-deuterio-9,10-dihydroacridine.
Molecular Properties
| Compound Name | 9-deuterio-9,10-dihydroacridine |
| PubChem CID | 100991515 |
| Molecular Formula | C13H11N |
| Molecular Weight | 182.24 g/mol |
| Exact Mass | 182.10 |
| IUPAC Name | 9-deuterio-9,10-dihydroacridine |
| SMILES | [2H]C1c2ccccc2Nc2ccccc21 |
| InChI | InChI=1S/C13H11N/c1-3-7-12-10(5-1)9-11-6-2-4-8-13(11)14-12/h1-8,14H,9H2/i9D |
| InChIKey | HJCUTNIGJHJGCF-QOWOAITPSA-N |
| XLogP | 3.33 |
| TPSA | 12.03 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | |
| Heavy Atoms | 14 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 182.24 |
| LogP ≤ 5 | 3.33 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 1 |
Analyze 9-deuterio-9,10-dihydroacridine with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 9-deuterio-9,10-dihydroacridine?
The IUPAC name of 9-deuterio-9,10-dihydroacridine (CID 100991515) is 9-deuterio-9,10-dihydroacridine.
What is the SMILES notation for 9-deuterio-9,10-dihydroacridine?
The canonical SMILES for 9-deuterio-9,10-dihydroacridine is [2H]C1c2ccccc2Nc2ccccc21.
What is the InChIKey of 9-deuterio-9,10-dihydroacridine?
The InChIKey is HJCUTNIGJHJGCF-QOWOAITPSA-N. The full InChI is InChI=1S/C13H11N/c1-3-7-12-10(5-1)9-11-6-2-4-8-13(11)14-12/h1-8,14H,9H2/i9D.
What are the key properties of 9-deuterio-9,10-dihydroacridine?
9-deuterio-9,10-dihydroacridine has a molecular weight of 182.24 g/mol, XLogP of 3.33, 0 rotatable bonds, 1 hydrogen bond donors, and 1 hydrogen bond acceptors.
Where does this data come from?
All data for 9-deuterio-9,10-dihydroacridine is sourced from PubChem (CID 100991515), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).